Preferred Name |
alverine citrate |
|
Synonyms |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate N-Ethyl-3,3'-diphenyldipropylamine citrate |
|
Definitions |
The citrate salt of alverine, resulting from the reaction of equimolar amounts of alvarine and citric acid. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used in the treatment of irritable bowel syndrome. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_53785 |
|
charge |
0 |
|
database_cross_reference |
PMID:20375645 PMID:20003095 Reaxys:3851428 PMID:19115153 CAS:5560-59-8 DrugBank:DB01616 PMID:17934514 PMID:21698811 PMID:15259090 PMID:20415841 PMID:12030962 Beilstein:3851428 PMID:19148544 KEGG:D02877 Patent:CN101838205 |
|
definition |
The citrate salt of alverine, resulting from the reaction of equimolar amounts of alvarine and citric acid. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used in the treatment of irritable bowel syndrome. |
|
formula |
C20H27N.C6H8O7 C26H35NO7 |
|
has part | ||
has_exact_synonym |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-Ethyl-3,3'-diphenyldipropylamine citrate |
|
id |
CHEBI:53785 |
|
in_subset | ||
inchi |
InChI=1S/C20H27N.C6H8O7/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,11-14H,2,9-10,15-18H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
|
inchikey |
RYHCACJBKCOBTJ-UHFFFAOYSA-N |
|
label |
alverine citrate |
|
mass |
473.55860 |
|
monoisotopicmass |
473.24135 |
|
notation |
CHEBI:53785 |
|
prefLabel |
alverine citrate |
|
RO_0000087 | ||
smiles |
OC(=O)CC(O)(CC(O)=O)C(O)=O.CCN(CCCc1ccccc1)CCCc1ccccc1 |
|
subClassOf |