Preferred Name |
flurazepam |
|
Synonyms |
7-chloro-1-[2-(diethylamino)ethyl]-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one flurazepamum Insumin Ro 5-6901 flurazepam |
|
Definitions |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a 2-(diethylamino)ethyl group, 2-fluorophenyl group and chloro group at positions 1, 5 and 7, respectively. It is a partial agonist of GABAA receptors and used for the treatment of insomnia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5128 |
|
charge |
0 |
|
database_cross_reference |
PMID:16501350 PMID:2863335 CAS:17617-23-1 KEGG:D00329 PMID:23035248 PMID:20002022 Drug_Central:1218 Wikipedia:Flurazepam DrugBank:DB00690 PDBeChem:FL7 HMDB:HMDB0014828 |
|
definition |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a 2-(diethylamino)ethyl group, 2-fluorophenyl group and chloro group at positions 1, 5 and 7, respectively. It is a partial agonist of GABAA receptors and used for the treatment of insomnia. |
|
formula |
C21H23ClFN3O |
|
has_exact_synonym |
7-chloro-1-[2-(diethylamino)ethyl]-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
flurazepamum Insumin Ro 5-6901 flurazepam |
|
id |
CHEBI:5128 |
|
in_subset | ||
inchi |
InChI=1S/C21H23ClFN3O/c1-3-25(4-2)11-12-26-19-10-9-15(22)13-17(19)21(24-14-20(26)27)16-7-5-6-8-18(16)23/h5-10,13H,3-4,11-12,14H2,1-2H3 |
|
inchikey |
SAADBVWGJQAEFS-UHFFFAOYSA-N |
|
label |
flurazepam |
|
mass |
387.880 |
|
monoisotopicmass |
387.15137 |
|
notation |
CHEBI:5128 |
|
prefLabel |
flurazepam |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35474 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
smiles |
C(CN(CC)CC)N1C=2C(C(=NCC1=O)C3=CC=CC=C3F)=CC(=CC2)Cl |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36683 http://purl.obolibrary.org/obo/CHEBI_35500 |