Preferred Name | flumazenil | |
Synonyms |
flumazenilum flumazenilo Anexate Lanexat flumazenil ethyl 8-fluoro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
|
Definitions |
An organic heterotricyclic compound that is 5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine which is substituted at positions 3, 5, 6, and 8 by ethoxycarbonyl, methyl, oxo, and fluoro groups, respectively. It is used as an antidote to benzodiazepine overdose. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5103 |
|
alternative term |
flumazenilum flumazenilo Anexate Lanexat flumazenil ethyl 8-fluoro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
|
bearer of | ||
charge |
0 |
|
database_cross_reference |
PMID:23431889 HMDB:HMDB0015336 PMID:24563235 PMID:23126253 CAS:78755-81-4 PMID:11881583 DrugBank:DB01205 LINCS:LSM-4228 Drug_Central:1195 Beilstein:4763661 Reaxys:4763661 PMID:26324010 Wikipedia:Flumazenil PMID:26469689 KEGG:D00697 KEGG:C07825 |
|
definition |
An organic heterotricyclic compound that is 5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine which is substituted at positions 3, 5, 6, and 8 by ethoxycarbonyl, methyl, oxo, and fluoro groups, respectively. It is used as an antidote to benzodiazepine overdose. |
|
formula |
C15H14FN3O3 |
|
has_exact_synonym |
ethyl 8-fluoro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
flumazenilum flumazenilo Anexate Lanexat flumazenil |
|
id |
CHEBI:5103 |
|
in_subset | ||
inchi |
InChI=1S/C15H14FN3O3/c1-3-22-15(21)13-12-7-18(2)14(20)10-6-9(16)4-5-11(10)19(12)8-17-13/h4-6,8H,3,7H2,1-2H3 |
|
inchikey |
OFBIFZUFASYYRE-UHFFFAOYSA-N |
|
label |
flumazenil |
|
mass |
303.289 |
|
monoisotopicmass |
303.10192 |
|
notation |
CHEBI:5103 |
|
prefLabel |
flumazenil |
|
RO_0000087 | ||
smiles |
C1=NC(=C2N1C=3C(C(N(C2)C)=O)=CC(=CC3)F)C(OCC)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 |