loading...| Preferred Name | fenoprofen | |
| Synonyms |
2-(m-phenoxyphenyl)propionic acid alpha-methyl-3-phenoxybenzeneacetic acid fenoprofenum 2-(3-phenoxyphenyl)propionic acid alpha-(m-phenoxyphenyl)propionic acid (+-)-m-phenoxyhydratropic acid fenoprofene fenoprofeno (+-)-2-(3-phenoxyphenyl)propionic acid fenoprofen 2-(3-phenoxyphenyl)propanoic acid FENOPROFEN Fenoprofen |
|
| Definitions |
A monocarboxylic acid that is propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5004 |
|
| alternative term |
2-(m-phenoxyphenyl)propionic acid alpha-methyl-3-phenoxybenzeneacetic acid fenoprofenum 2-(3-phenoxyphenyl)propionic acid alpha-(m-phenoxyphenyl)propionic acid (+-)-m-phenoxyhydratropic acid fenoprofene fenoprofeno (+-)-2-(3-phenoxyphenyl)propionic acid fenoprofen 2-(3-phenoxyphenyl)propanoic acid FENOPROFEN Fenoprofen |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_88188 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C06997 PMID:4616811 Wikipedia:_Fenoprofen PMID:21328296 DrugBank:DB00573 PMID:25554116 PMID:21342694 PMID:30168706 Drug_Central:1154 PMID:28166217 Patent:US3600437 CAS:31879-05-7 KEGG:D02350 Reaxys:2118687 |
|
| definition |
A monocarboxylic acid that is propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding. |
|
| formula |
C15H14O3 |
|
| has_alternative_id |
CHEBI:355534 |
|
| has_exact_synonym |
2-(3-phenoxyphenyl)propanoic acid FENOPROFEN Fenoprofen |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(m-phenoxyphenyl)propionic acid alpha-methyl-3-phenoxybenzeneacetic acid fenoprofenum 2-(3-phenoxyphenyl)propionic acid alpha-(m-phenoxyphenyl)propionic acid (+-)-m-phenoxyhydratropic acid fenoprofene fenoprofeno (+-)-2-(3-phenoxyphenyl)propionic acid fenoprofen |
|
| id |
CHEBI:5004 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17) |
|
| inchikey |
RDJGLLICXDHJDY-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
fenoprofen |
|
| mass |
242.26990 |
|
| monoisotopicmass |
242.09429 |
|
| notation |
CHEBI:5004 |
|
| prefLabel |
fenoprofen |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_88188 |
|
| smiles |
CC(C(O)=O)c1cccc(Oc2ccccc2)c1 |
|
| subClassOf |