loading...| Preferred Name | esmolol hydrochloride | |
| Synonyms |
esmolol HCl 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester HCl methyl p-(2-hydroxy-3-(isopropylamino)propoxy)hydrocinnamate hydrochloride 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester hydrochloride methyl 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate hydrochloride (+-)-esmolol hydrochloride (+-)-methyl p-(2-hydroxy-3-(isopropylamino)propoxy)hydrocinnamate hydrochloride 2-hydroxy-3-[4-(3-methoxy-3-oxopropyl)phenoxy]-N-(propan-2-yl)propan-1-aminium chloride |
|
| Definitions |
The hydrochloride salt of esmolol. A cardioselective and short-acting beta1 receptor blocker with rapid onset but lacking intrinsic sympathomimetic and membrane-stabilising properties, it is used in the management of supraventricular arrhythmias, and for the control of hypertension and tachycardia during surgery. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4857 |
|
| alternative term |
esmolol HCl 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester HCl methyl p-(2-hydroxy-3-(isopropylamino)propoxy)hydrocinnamate hydrochloride 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester hydrochloride methyl 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate hydrochloride (+-)-esmolol hydrochloride (+-)-methyl p-(2-hydroxy-3-(isopropylamino)propoxy)hydrocinnamate hydrochloride 2-hydroxy-3-[4-(3-methoxy-3-oxopropyl)phenoxy]-N-(propan-2-yl)propan-1-aminium chloride |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Beilstein:5185568 CAS:81161-17-3 KEGG:D00644 PMID:1642945 DrugBank:DB00187 |
|
| definition |
The hydrochloride salt of esmolol. A cardioselective and short-acting beta1 receptor blocker with rapid onset but lacking intrinsic sympathomimetic and membrane-stabilising properties, it is used in the management of supraventricular arrhythmias, and for the control of hypertension and tachycardia during surgery. |
|
| formula |
C16H26ClNO4 |
|
| has part | ||
| has_exact_synonym |
2-hydroxy-3-[4-(3-methoxy-3-oxopropyl)phenoxy]-N-(propan-2-yl)propan-1-aminium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
esmolol HCl 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester HCl methyl p-(2-hydroxy-3-(isopropylamino)propoxy)hydrocinnamate hydrochloride 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester hydrochloride methyl 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate hydrochloride (+-)-esmolol hydrochloride (+-)-methyl p-(2-hydroxy-3-(isopropylamino)propoxy)hydrocinnamate hydrochloride |
|
| id |
CHEBI:4857 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H25NO4.ClH/c1-12(2)17-10-14(18)11-21-15-7-4-13(5-8-15)6-9-16(19)20-3;/h4-5,7-8,12,14,17-18H,6,9-11H2,1-3H3;1H |
|
| inchikey |
GEKNCWBANDDJJL-UHFFFAOYSA-N |
|
| label |
esmolol hydrochloride |
|
| mass |
331.83500 |
|
| monoisotopicmass |
331.15504 |
|
| notation |
CHEBI:4857 |
|
| overlaps | ||
| prefLabel |
esmolol hydrochloride |
|
| RO_0000087 | ||
| smiles |
[Cl-].COC(=O)CCc1ccc(OCC(O)C[NH2+]C(C)C)cc1 |
|
| subClassOf |