loading...| Preferred Name |
benzothiazole |
|
| Synonyms |
BENZOTHIAZOLE 1,3-benzothiazole 1-Thia-3-azaindene Benzothiazol Benzosulfonazole BT |
|
| Definitions |
An organic heterobicyclic compound that is a fusion product between benzene and thiazole. The parent of the class of benzothiazoles. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_45993 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:15750776 Beilstein:109468 HMDB:HMDB0032930 PMID:24248888 PMID:23500410 UM-BBD_compID:c1128 Wikipedia:Benzothiazole CAS:95-16-9 PMID:18568896 DrugBank:DB08624 Reaxys:109468 PDBeChem:THZ |
|
| definition |
An organic heterobicyclic compound that is a fusion product between benzene and thiazole. The parent of the class of benzothiazoles. |
|
| formula |
C7H5NS |
|
| has_exact_synonym |
BENZOTHIAZOLE 1,3-benzothiazole |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-Thia-3-azaindene Benzothiazol Benzosulfonazole BT |
|
| id |
CHEBI:45993 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H5NS/c1-2-4-7-6(3-1)8-5-9-7/h1-5H |
|
| inchikey |
IOJUPLGTWVMSFF-UHFFFAOYSA-N |
|
| label |
benzothiazole |
|
| mass |
135.18734 |
|
| monoisotopicmass |
135.01427 |
|
| notation |
CHEBI:45993 |
|
| prefLabel |
benzothiazole |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| smiles |
c1ccc2scnc2c1 |
|
| subClassOf |