Preferred Name |
vorinostat |
|
Synonyms |
N-hydroxy-N'-phenyloctanediamide suberoylanilide hydroxamic acid octanedioic acid hydroxyamide phenylamide vorinostatum Suberanilohydroxamic acid SAHA SHH Zolinza vorinostat |
|
Definitions |
A dicarboxylic acid diamide comprising suberic (octanedioic) acid coupled to aniline and hydroxylamine. A histone deacetylase inhibitor, it is marketed under the name Zolinza for the treatment of cutaneous T cell lymphoma (CTCL). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_45716 |
|
charge |
0 |
|
database_cross_reference |
Patent:NZ592686 PMID:23758082 PMID:22887890 PMID:23864881 PMID:23820962 HMDB:HMDB0015568 PMID:21657958 Patent:WO2008106524 Patent:CN102641261 PDBeChem:SHH KEGG:D06320 PMID:23320102 DrugBank:DB02546 Drug_Central:4124 Reaxys:7213017 Wikipedia:Vorinostat PMID:23348693 PMID:23708756 CAS:149647-78-9 Patent:US2011039937 LINCS:LSM-3828 Patent:KR20110045493 |
|
definition |
A dicarboxylic acid diamide comprising suberic (octanedioic) acid coupled to aniline and hydroxylamine. A histone deacetylase inhibitor, it is marketed under the name Zolinza for the treatment of cutaneous T cell lymphoma (CTCL). |
|
formula |
C14H20N2O3 |
|
has_exact_synonym |
N-hydroxy-N'-phenyloctanediamide |
|
has_functional_parent |
http://purl.obolibrary.org/obo/CHEBI_17296 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
suberoylanilide hydroxamic acid octanedioic acid hydroxyamide phenylamide vorinostatum Suberanilohydroxamic acid SAHA SHH Zolinza vorinostat |
|
id |
CHEBI:45716 |
|
in_subset | ||
inchi |
InChI=1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
|
inchikey |
WAEXFXRVDQXREF-UHFFFAOYSA-N |
|
label |
vorinostat |
|
mass |
264.32020 |
|
monoisotopicmass |
264.14739 |
|
notation |
CHEBI:45716 |
|
prefLabel |
vorinostat |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
smiles |
ONC(=O)CCCCCCC(=O)Nc1ccccc1 |
|
subClassOf |