loading...| Preferred Name |
phenazine |
|
| Synonyms |
phenazine 9,10-diazaanthracene dibenzoparadiazine azophenylene dibenzo-p-diazine dibenzopyrazine acridizine |
|
| Definitions |
An azaarene that is anthracene in which the carbon atoms at positions 9 and 10 are replaced by nitrogen atoms. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36674 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:201469 Beilstein:126500 PMID:24482022 Reaxys:126500 CAS:92-82-0 MetaCyc:CPD-12873 Wikipedia:Phenazine |
|
| definition |
An azaarene that is anthracene in which the carbon atoms at positions 9 and 10 are replaced by nitrogen atoms. |
|
| formula |
C12H8N2 |
|
| has_exact_synonym |
phenazine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
9,10-diazaanthracene dibenzoparadiazine azophenylene dibenzo-p-diazine dibenzopyrazine acridizine |
|
| id |
CHEBI:36674 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H8N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H |
|
| inchikey |
PCNDJXKNXGMECE-UHFFFAOYSA-N |
|
| label |
phenazine |
|
| mass |
180.20540 |
|
| monoisotopicmass |
180.06875 |
|
| notation |
CHEBI:36674 |
|
| prefLabel |
phenazine |
|
| smiles |
c1ccc2nc3ccccc3nc2c1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36416 http://purl.obolibrary.org/obo/CHEBI_39201 http://purl.obolibrary.org/obo/CHEBI_50893 |