loading...| Preferred Name | chlorphenesin | |
| Synonyms |
clorfenesina 3-(p-chlorophenoxy)-1,2-propanediol chlorphenesine glycerol alpha-p-chlorophenyl ether chlorphenesin chlorphenesinum p-chlorophenyl-alpha-glyceryl ether 3-(p-chlorophenoxy)propane-1,2-diol 3-(4-chlorophenoxy)-1,2-propanediol 3-(4-chlorophenoxy)propane-1,2-diol Chlorphenesin |
|
| Definitions |
Glycerol in which the hydrogen of one of the primary hydroxy groups is substituted by a 4-chlorophenyl group. It has antifungal and antibacterial properties, and is used for treatment of cutaneous and vaginal infections. Its 1-carbamate is used as a skeletal muscle relaxant for the treatment of painful muscle spasm. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3642 |
|
| alternative term |
clorfenesina 3-(p-chlorophenoxy)-1,2-propanediol chlorphenesine glycerol alpha-p-chlorophenyl ether chlorphenesin chlorphenesinum p-chlorophenyl-alpha-glyceryl ether 3-(p-chlorophenoxy)propane-1,2-diol 3-(4-chlorophenoxy)-1,2-propanediol 3-(4-chlorophenoxy)propane-1,2-diol Chlorphenesin |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:104-29-0 PMID:17178228 KEGG:C07928 Reaxys:2210845 DrugBank:DB00856 Patent:US2468423 Wikipedia:Chlorphenesin Beilstein:2210845 Patent:GB628497 |
|
| definition |
Glycerol in which the hydrogen of one of the primary hydroxy groups is substituted by a 4-chlorophenyl group. It has antifungal and antibacterial properties, and is used for treatment of cutaneous and vaginal infections. Its 1-carbamate is used as a skeletal muscle relaxant for the treatment of painful muscle spasm. |
|
| formula |
C9H11ClO3 |
|
| has_alternative_id |
CHEBI:480431 CHEBI:704618 |
|
| has_exact_synonym |
chlorphenesin 3-(4-chlorophenoxy)propane-1,2-diol Chlorphenesin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
clorfenesina 3-(p-chlorophenoxy)-1,2-propanediol chlorphenesine glycerol alpha-p-chlorophenyl ether chlorphenesin chlorphenesinum p-chlorophenyl-alpha-glyceryl ether 3-(p-chlorophenoxy)propane-1,2-diol 3-(4-chlorophenoxy)-1,2-propanediol |
|
| id |
CHEBI:3642 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H11ClO3/c10-7-1-3-9(4-2-7)13-6-8(12)5-11/h1-4,8,11-12H,5-6H2 |
|
| inchikey |
MXOAEAUPQDYUQM-UHFFFAOYSA-N |
|
| label |
chlorphenesin |
|
| mass |
202.63500 |
|
| monoisotopicmass |
202.03967 |
|
| notation |
CHEBI:3642 |
|
| prefLabel |
chlorphenesin |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
| smiles |
OCC(O)COc1ccc(Cl)cc1 |
|
| subClassOf |