loading...| Preferred Name | chloroprocaine | |
| Synonyms |
4-amino-2-chlorobenzoic acid 2-(diethylamino)ethyl ester chloroprocaine 2-chloroprocaine cloroprocaina chloroprocainum chloroprocain 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate Chloroprocaine |
|
| Definitions |
Procaine in which one of the hydrogens ortho- to the carboxylic acid group is substituted by chlorine. It is used as its monohydrochloride salt as a local anaesthetic, particularly for oral surgery. It has the advantage over lidocaine of constricting blood vessels, so reducing bleeding. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3636 |
|
| alternative term |
4-amino-2-chlorobenzoic acid 2-(diethylamino)ethyl ester chloroprocaine 2-chloroprocaine cloroprocaina chloroprocainum chloroprocain 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate Chloroprocaine |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_49110 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Chloroprocaine DrugBank:DB01161 KEGG:D07678 KEGG:C07877 Drug_Central:605 Beilstein:2808071 CAS:133-16-4 |
|
| definition |
Procaine in which one of the hydrogens ortho- to the carboxylic acid group is substituted by chlorine. It is used as its monohydrochloride salt as a local anaesthetic, particularly for oral surgery. It has the advantage over lidocaine of constricting blood vessels, so reducing bleeding. |
|
| formula |
C13H19ClN2O2 |
|
| has_exact_synonym |
2-(diethylamino)ethyl 4-amino-2-chlorobenzoate Chloroprocaine |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-amino-2-chlorobenzoic acid 2-(diethylamino)ethyl ester chloroprocaine 2-chloroprocaine cloroprocaina chloroprocainum chloroprocain |
|
| id |
CHEBI:3636 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H19ClN2O2/c1-3-16(4-2)7-8-18-13(17)11-6-5-10(15)9-12(11)14/h5-6,9H,3-4,7-8,15H2,1-2H3 |
|
| inchikey |
VDANGULDQQJODZ-UHFFFAOYSA-N |
|
| label |
chloroprocaine |
|
| mass |
270.75500 |
|
| monoisotopicmass |
270.11351 |
|
| notation |
CHEBI:3636 |
|
| prefLabel |
chloroprocaine |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_49110 |
|
| smiles |
CCN(CC)CCOC(=O)c1ccc(N)cc1Cl |
|
| subClassOf |