loading...| Preferred Name |
protirelin |
|
| Synonyms |
5-oxo-L-prolyl-L-histidyl-L-prolinamide Protirelin TSH-releasing factor Thyrotropic-releasing factor TSH-releasing hormone Thyroliberin Thyrotropin releasing hormone Thyrotropic releasing hormone Thyrotropin-releasing factor L-Pyroglutamyl-L-histidyl-L-prolineamide TRH |
|
| Definitions |
A tripeptide composed of L-pyroglutamyl, L-histidyl and L-prolinamide residues joined in sequence. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35940 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:4985794 Beilstein:903432 KEGG:D00176 KEGG:C03958 Reaxys:903432 Drug_Central:2316 Wikipedia:Protirelin CAS:24305-27-9 HMDB:HMDB0005763 PMID:14087521 |
|
| definition |
A tripeptide composed of L-pyroglutamyl, L-histidyl and L-prolinamide residues joined in sequence. |
|
| formula |
C16H22N6O4 |
|
| has_alternative_id |
CHEBI:8584 CHEBI:9585 |
|
| has_exact_synonym |
5-oxo-L-prolyl-L-histidyl-L-prolinamide Protirelin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
TSH-releasing factor Thyrotropic-releasing factor TSH-releasing hormone Thyroliberin Thyrotropin releasing hormone Thyrotropic releasing hormone Thyrotropin-releasing factor L-Pyroglutamyl-L-histidyl-L-prolineamide TRH |
|
| id |
CHEBI:35940 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H22N6O4/c17-14(24)12-2-1-5-22(12)16(26)11(6-9-7-18-8-19-9)21-15(25)10-3-4-13(23)20-10/h7-8,10-12H,1-6H2,(H2,17,24)(H,18,19)(H,20,23)(H,21,25)/t10-,11-,12-/m0/s1 |
|
| inchikey |
XNSAINXGIQZQOO-SRVKXCTJSA-N |
|
| label |
protirelin |
|
| mass |
362.38392 |
|
| monoisotopicmass |
362.17025 |
|
| notation |
CHEBI:35940 |
|
| prefLabel |
protirelin |
|
| RO_0000087 | ||
| smiles |
NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCC(=O)N1 |
|
| subClassOf |