Preferred Name |
thiouracil |
|
Synonyms |
2-thioxo-2,3-dihydropyrimidin-4(1H)-one 2-Thiouracil 2-mercapto-4-pyrimidinol 4-Hydroxy-2-pyrimidinethiol 2-Mercapto-pyrimidin-4-ol 2-Thioxo-2,3-dihydro-1H-pyrimidin-4-one 2-Thio-2,4-(1H,3H)-pyrimidinedione |
|
Definitions |
A nucleobase analogue that is uracil in which the oxo group at C-2 is replaced by a thioxo group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_348530 |
|
charge |
0 |
|
database_cross_reference |
PMID:23740976 KEGG:C19304 Wikipedia:Thiouracil Reaxys:112227 CAS:141-90-2 PMID:8978847 PMID:23739752 Drug_Central:2640 PMID:8068712 PMID:4316226 PMID:11094150 PMID:3654008 PMID:7120285 Beilstein:112227 |
|
definition |
A nucleobase analogue that is uracil in which the oxo group at C-2 is replaced by a thioxo group. |
|
formula |
C4H4N2OS |
|
has_exact_synonym |
2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Thiouracil 2-mercapto-4-pyrimidinol 4-Hydroxy-2-pyrimidinethiol 2-Mercapto-pyrimidin-4-ol 2-Thioxo-2,3-dihydro-1H-pyrimidin-4-one 2-Thio-2,4-(1H,3H)-pyrimidinedione |
|
id |
CHEBI:348530 |
|
in_subset | ||
inchi |
InChI=1S/C4H4N2OS/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
|
inchikey |
ZEMGGZBWXRYJHK-UHFFFAOYSA-N |
|
label |
thiouracil |
|
mass |
128.15200 |
|
monoisotopicmass |
128.00443 |
|
notation |
CHEBI:348530 |
|
prefLabel |
thiouracil |
|
RO_0000087 | ||
smiles |
O=c1cc[nH]c(=S)[nH]1 |
|
subClassOf |