Preferred Name |
carmustine |
|
Synonyms |
1,3-bis(2-chloroethyl)-1-nitrosourea Carmustine N,N'-Bis(2-chloroethyl)-N-nitrosourea Bischloroethyl nitrosourea carmustinum BCNU Bicnu (TN) Gliadel carmustina carmustine |
|
Definitions |
A member of the class of N-nitrosoureas that is 1,3-bis(2-chloroethyl)urea in which one of the nitrogens is substituted by a nitroso group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3423 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:512 CAS:154-93-8 KEGG:D00254 DrugBank:DB00262 Wikipedia:Carmustine |
|
definition |
A member of the class of N-nitrosoureas that is 1,3-bis(2-chloroethyl)urea in which one of the nitrogens is substituted by a nitroso group. |
|
formula |
C5H9Cl2N3O2 |
|
has_exact_synonym |
1,3-bis(2-chloroethyl)-1-nitrosourea Carmustine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N,N'-Bis(2-chloroethyl)-N-nitrosourea Bischloroethyl nitrosourea carmustinum BCNU Bicnu (TN) Gliadel carmustina carmustine |
|
id |
CHEBI:3423 |
|
in_subset | ||
inchi |
InChI=1S/C5H9Cl2N3O2/c6-1-3-8-5(11)10(9-12)4-2-7/h1-4H2,(H,8,11) |
|
inchikey |
DLGOEMSEDOSKAD-UHFFFAOYSA-N |
|
label |
carmustine |
|
mass |
214.05000 |
|
monoisotopicmass |
213.00718 |
|
notation |
CHEBI:3423 |
|
prefLabel |
carmustine |
|
RO_0000087 | ||
smiles |
ClCCNC(=O)N(CCCl)N=O |
|
subClassOf |