loading...| Preferred Name | remifentanil hydrochloride | |
| Synonyms |
remifentanil HCl Ultiva 4-(methoxycarbonyl)-1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidinium chloride methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate hydrochloride |
|
| Definitions |
The monohydrochloride salt of remifentanil. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_32091 |
|
| alternative term |
remifentanil HCl Ultiva 4-(methoxycarbonyl)-1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidinium chloride methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate hydrochloride |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_55322 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:132539-07-2 Reaxys:8660300 DrugBank:DB00899 KEGG:D01177 |
|
| definition |
The monohydrochloride salt of remifentanil. |
|
| formula |
C20H29ClN2O5 |
|
| has part | ||
| has_exact_synonym |
4-(methoxycarbonyl)-1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidinium chloride methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
remifentanil HCl Ultiva |
|
| id |
CHEBI:32091 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H28N2O5.ClH/c1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2;/h5-9H,4,10-15H2,1-3H3;1H |
|
| inchikey |
WFBMIPUMYUHANP-UHFFFAOYSA-N |
|
| label |
remifentanil hydrochloride |
|
| mass |
412.90800 |
|
| monoisotopicmass |
412.17650 |
|
| notation |
CHEBI:32091 |
|
| overlaps | ||
| prefLabel |
remifentanil hydrochloride |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_55322 |
|
| smiles |
[Cl-].CCC(=O)N(c1ccccc1)C1(CC[NH+](CCC(=O)OC)CC1)C(=O)OC |
|
| subClassOf |