Preferred Name |
pitavastatin |
|
Synonyms |
pitavastatinum pitavastatia pitavastatin pitavastatine NK 104 NK-104 (3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
|
Definitions |
A dihydroxy monocarboxylic acid that is (6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]hept-6-enoic acid in which the two hydroxy groups are located at positions 3 and 5 (the 3R,5S-stereoisomer). Used as its calcium salt for treatment of hypercholesterolemia (elevated levels of cholesterol in the blood) on patients unable to sufficiently lower their cholesterol levels by diet and exercise. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_32020 |
|
alternative term |
pitavastatinum pitavastatia pitavastatin pitavastatine NK 104 NK-104 (3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
|
bearer of | ||
charge |
0 |
|
database_cross_reference |
Patent:US2011269962 HMDB:HMDB0041991 Patent:EP2141155 PMID:22410289 PMID:22332608 PMID:22268518 PMID:22149769 Patent:US2012016129 PMID:22948417 PMID:22053916 Reaxys:7257773 CAS:147511-69-1 PMID:22679249 PMID:21075465 PMID:22807641 PMID:23007012 PMID:21884024 PMID:22878405 PMID:22520230 PMID:22472908 PMID:21585411 PMID:22133277 PMID:22356292 KEGG:C13334 PMID:22361916 PMID:22627182 PMID:22345687 Wikipedia:Pitavastatin PMID:22884685 PMID:22077103 Drug_Central:2214 PMID:22850760 PMID:23161429 |
|
definition |
A dihydroxy monocarboxylic acid that is (6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]hept-6-enoic acid in which the two hydroxy groups are located at positions 3 and 5 (the 3R,5S-stereoisomer). Used as its calcium salt for treatment of hypercholesterolemia (elevated levels of cholesterol in the blood) on patients unable to sufficiently lower their cholesterol levels by diet and exercise. |
|
formula |
C25H24FNO4 |
|
has_exact_synonym |
(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
pitavastatinum pitavastatia pitavastatin pitavastatine NK 104 NK-104 |
|
id |
CHEBI:32020 |
|
in_subset | ||
inchi |
InChI=1S/C25H24FNO4/c26-17-9-7-15(8-10-17)24-20-3-1-2-4-22(20)27-25(16-5-6-16)21(24)12-11-18(28)13-19(29)14-23(30)31/h1-4,7-12,16,18-19,28-29H,5-6,13-14H2,(H,30,31)/b12-11+/t18-,19-/m1/s1 |
|
inchikey |
VGYFMXBACGZSIL-MCBHFWOFSA-N |
|
is_conjugate_acid_of | ||
label |
pitavastatin |
|
mass |
421.46080 |
|
monoisotopicmass |
421.16894 |
|
notation |
CHEBI:32020 |
|
prefLabel |
pitavastatin |
|
RO_0000087 | ||
smiles |
O[C@H](C[C@H](O)\C=C\c1c(nc2ccccc2c1-c1ccc(F)cc1)C1CC1)CC(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_51454 http://purl.obolibrary.org/obo/CHEBI_87635 http://purl.obolibrary.org/obo/CHEBI_26513 |