loading...| Preferred Name | nateglinide | |
| Synonyms |
(-)-N-(trans-4-isopropylcyclohexanecarbonyl)-D-phenylalanine nateglinidum trans-N-{[4-(1-methylethyl)cyclohexyl]carbonyl}-D-phenylalanine nateglinida nateglinide A 4166 A-4166 AY 4166 AY-4166 AY4166 Fastic Starlix Starsis N-[(trans-4-isopropylcyclohexyl)carbonyl]-D-phenylalanine |
|
| Definitions |
An N-acyl-D-phenylalanine resulting from the formal condensation of the amino group of D-phenylalanine with the carboxy group of trans-4-isopropylcyclohexanecarboxylic acid. An orally-administered, rapidly-absorbed, short-acting insulinotropic agent, it is used for the treatment of type 2 diabetes mellitus. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31897 |
|
| alternative term |
(-)-N-(trans-4-isopropylcyclohexanecarbonyl)-D-phenylalanine nateglinidum trans-N-{[4-(1-methylethyl)cyclohexyl]carbonyl}-D-phenylalanine nateglinida nateglinide A 4166 A-4166 AY 4166 AY-4166 AY4166 Fastic Starlix Starsis N-[(trans-4-isopropylcyclohexyl)carbonyl]-D-phenylalanine |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00731 KEGG:C12508 PMID:23675267 KEGG:D01111 PMID:18200800 PMID:21801074 PMID:11724096 Wikipedia:Nateglinide PMID:12918894 Patent:US4816484 PMID:17253883 PMID:23867985 PMID:24563597 Drug_Central:1886 PMID:10820657 PMID:23935065 PMID:23229379 PMID:16178991 CAS:105816-04-4 PMID:12652357 Patent:EP196222 PMID:19337530 PMID:11585005 PMID:17573070 PMID:23872227 HMDB:HMDB0014869 PMID:14748619 |
|
| definition |
An N-acyl-D-phenylalanine resulting from the formal condensation of the amino group of D-phenylalanine with the carboxy group of trans-4-isopropylcyclohexanecarboxylic acid. An orally-administered, rapidly-absorbed, short-acting insulinotropic agent, it is used for the treatment of type 2 diabetes mellitus. |
|
| formula |
C19H27NO3 |
|
| has_exact_synonym |
N-[(trans-4-isopropylcyclohexyl)carbonyl]-D-phenylalanine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(-)-N-(trans-4-isopropylcyclohexanecarbonyl)-D-phenylalanine nateglinidum trans-N-{[4-(1-methylethyl)cyclohexyl]carbonyl}-D-phenylalanine nateglinida nateglinide A 4166 A-4166 AY 4166 AY-4166 AY4166 Fastic Starlix Starsis |
|
| id |
CHEBI:31897 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H27NO3/c1-13(2)15-8-10-16(11-9-15)18(21)20-17(19(22)23)12-14-6-4-3-5-7-14/h3-7,13,15-17H,8-12H2,1-2H3,(H,20,21)(H,22,23)/t15-,16-,17-/m1/s1 |
|
| inchikey |
OELFLUMRDSZNSF-BRWVUGGUSA-N |
|
| label |
nateglinide |
|
| mass |
317.42260 |
|
| monoisotopicmass |
317.19909 |
|
| notation |
CHEBI:31897 |
|
| prefLabel |
nateglinide |
|
| RO_0000087 | ||
| smiles |
CC(C)[C@H]1CC[C@@H](CC1)C(=O)N[C@H](Cc1ccccc1)C(O)=O |
|
| subClassOf |