loading...| Preferred Name |
fluocinolone acetonide |
|
| Synonyms |
(4aS,4bR,5S,6aS,6bS,9aR,10aS,10bS,12S)-4b,12-difluoro-6b-glycoloyl-5-hydroxy-4a,6a,8,8-tetramethyl-4a,4b,5,6,6a,6b,9a,10,10a,10b,11,12-dodecahydro-2H-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-2-one fluocinolone 16,17-acetonide acetonido de fluocinolona Derma-Smoothe/FS 6alpha-fluorotriamcinolone acetonide acetonide de fluocinolone fluocinoloni acetonidum Cortiplastol fluocinolone acetonide 6alpha,9alpha-difluoro-16alpha-hydroxyprednisolone 16,17-acetonide Coriphate Dermalar Flucinar Flucort Fluocet Fluonid Fluotrex Fluovitif Flupollon Fluzon Iluvien Jellin Localyn Omniderm Percutina Prodermin Radiocin Retisert Sinalar Synalar Synamol Synandone Synandrone Synemol Synotic Synsac Tefunote |
|
| Definitions |
A fluorinated steroid that is flunisolide in which the hydrogen at position 9 is replaced by fluorine. A corticosteroid with glucocorticoid activity, it is used (both as the anhydrous form and as the dihydrate) in creams, gels and ointments for the treatment of various skin disorders. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31623 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23323586 HMDB:HMDB0014729 DrugBank:DB00591 Drug_Central:1204 PMID:21459216 KEGG:D01825 Reaxys:1358396 PMID:21277557 Patent:US3014938 Patent:US3126375 PMID:23321234 PMID:21238799 Wikipedia:Fluocinolone_acetonide CAS:67-73-2 |
|
| definition |
A fluorinated steroid that is flunisolide in which the hydrogen at position 9 is replaced by fluorine. A corticosteroid with glucocorticoid activity, it is used (both as the anhydrous form and as the dihydrate) in creams, gels and ointments for the treatment of various skin disorders. |
|
| formula |
C24H30F2O6 |
|
| has_exact_synonym |
(4aS,4bR,5S,6aS,6bS,9aR,10aS,10bS,12S)-4b,12-difluoro-6b-glycoloyl-5-hydroxy-4a,6a,8,8-tetramethyl-4a,4b,5,6,6a,6b,9a,10,10a,10b,11,12-dodecahydro-2H-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-2-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
fluocinolone 16,17-acetonide acetonido de fluocinolona Derma-Smoothe/FS 6alpha-fluorotriamcinolone acetonide acetonide de fluocinolone fluocinoloni acetonidum Cortiplastol fluocinolone acetonide 6alpha,9alpha-difluoro-16alpha-hydroxyprednisolone 16,17-acetonide Coriphate Dermalar Flucinar Flucort Fluocet Fluonid Fluotrex Fluovitif Flupollon Fluzon Iluvien Jellin Localyn Omniderm Percutina Prodermin Radiocin Retisert Sinalar Synalar Synamol Synandone Synandrone Synemol Synotic Synsac Tefunote |
|
| id |
CHEBI:31623 |
|
| in_subset | ||
| inchi |
InChI=1S/C24H30F2O6/c1-20(2)31-19-9-13-14-8-16(25)15-7-12(28)5-6-21(15,3)23(14,26)17(29)10-22(13,4)24(19,32-20)18(30)11-27/h5-7,13-14,16-17,19,27,29H,8-11H2,1-4H3/t13-,14-,16-,17-,19+,21-,22-,23-,24+/m0/s1 |
|
| inchikey |
FEBLZLNTKCEFIT-VSXGLTOVSA-N |
|
| label |
fluocinolone acetonide |
|
| mass |
452.48820 |
|
| monoisotopicmass |
452.20105 |
|
| notation |
CHEBI:31623 |
|
| prefLabel |
fluocinolone acetonide |
|
| RO_0000087 | ||
| smiles |
CC1(C)O[C@@H]2C[C@H]3[C@@H]4C[C@H](F)C5=CC(=O)C=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@]3(C)[C@@]2(O1)C(=O)CO |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139590 http://purl.obolibrary.org/obo/CHEBI_38164 http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_77166 http://purl.obolibrary.org/obo/CHEBI_50830 http://purl.obolibrary.org/obo/CHEBI_59779 |