Preferred Name |
flunitrazepam |
|
Synonyms |
5-(2-fluorophenyl)-1-methyl-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one 1-methyl-7-nitro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2(1H)-one 1,3-dihydro-5-(o-fluorophenyl)-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one flunitrazepam flunitrazepamum fluridrazepam flunidazepam 5-(o-fluorophenyl)-1,3-dihydro-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one Fluninoc Flunipam Flunita Fluscand Hipnosedon Hypnodorm Hypnor Narcozep Primum RO 5-4200 RO-5-4200 RO-54200 RO54200 Rohypnol Roipnol Silece Valsera |
|
Definitions |
A 1,4-benzodiazepinone that is nitrazepam substituted by a methyl group at position 1 and by a fluoro group at position 2'. It is a potent hypnotic, sedative, and amnestic drug used to treat chronic insomnia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31622 |
|
charge |
0 |
|
database_cross_reference |
PMID:31512527 PMID:30870640 Drug_Central:1202 PMID:27143233 PMID:31233253 Wikipedia:Flunitrazepam PMID:862358 PMID:11393809 PMID:25467462 PMID:27778423 PMID:28403803 PMID:26990972 PMID:29657737 PMID:25895512 DrugBank:DB01544 Reaxys:0702691 PMID:27747877 KEGG:D01230 CAS:1622-62-4 PMID:31679602 PMID:29713800 HMDB:HMDB0015510 PMID:23971077 PMID:17889 PMID:18070 PMID:19839 PMID:23506 |
|
definition |
A 1,4-benzodiazepinone that is nitrazepam substituted by a methyl group at position 1 and by a fluoro group at position 2'. It is a potent hypnotic, sedative, and amnestic drug used to treat chronic insomnia. |
|
formula |
C16H12FN3O3 |
|
has_exact_synonym |
5-(2-fluorophenyl)-1-methyl-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1-methyl-7-nitro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2(1H)-one 1,3-dihydro-5-(o-fluorophenyl)-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one flunitrazepam flunitrazepamum fluridrazepam flunidazepam 5-(o-fluorophenyl)-1,3-dihydro-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one Fluninoc Flunipam Flunita Fluscand Hipnosedon Hypnodorm Hypnor Narcozep Primum RO 5-4200 RO-5-4200 RO-54200 RO54200 Rohypnol Roipnol Silece Valsera |
|
id |
CHEBI:31622 |
|
in_subset | ||
inchi |
InChI=1S/C16H12FN3O3/c1-19-14-7-6-10(20(22)23)8-12(14)16(18-9-15(19)21)11-4-2-3-5-13(11)17/h2-8H,9H2,1H3 |
|
inchikey |
PPTYJKAXVCCBDU-UHFFFAOYSA-N |
|
label |
flunitrazepam |
|
mass |
313.288 |
|
monoisotopicmass |
313.08627 |
|
notation |
CHEBI:31622 |
|
prefLabel |
flunitrazepam |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35474 |
|
smiles |
C=12C(C=3C=CC=CC3F)=NCC(N(C1C=CC(=C2)[N+](=O)[O-])C)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35500 |