loading...| Preferred Name | crotamiton | |
| Synonyms |
crotamitonum crotamitone N-ethyl-o-crotonotoluidide crotonyl-N-ethyl-o-toluidine crotalgin crotamiton N-ethyl-N-(2-methylphenyl)but-2-enamide |
|
| Definitions |
An enamide resulting from the formal condensation of crotonic acid with N-ethyl-2-methylaniline. A colourless or pale yellow oily liquid, it is used in the treatment of pruritus (itching) by producing a counter-irritation: as it evaporates from the skin, it produces a cooling effect that diverts attention away from the itching. It has also been used as an acaricide in the treatment of scabies, though more effective drugs are usually preferred. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31439 |
|
| alternative term |
crotamitonum crotamitone N-ethyl-o-crotonotoluidide crotonyl-N-ethyl-o-toluidine crotalgin crotamiton N-ethyl-N-(2-methylphenyl)but-2-enamide |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00265 CAS:483-63-6 Drug_Central:744 LINCS:LSM-3274 Beilstein:3275497 KEGG:D01381 Patent:GB615137 |
|
| definition |
An enamide resulting from the formal condensation of crotonic acid with N-ethyl-2-methylaniline. A colourless or pale yellow oily liquid, it is used in the treatment of pruritus (itching) by producing a counter-irritation: as it evaporates from the skin, it produces a cooling effect that diverts attention away from the itching. It has also been used as an acaricide in the treatment of scabies, though more effective drugs are usually preferred. |
|
| formula |
C13H17NO |
|
| has_exact_synonym |
N-ethyl-N-(2-methylphenyl)but-2-enamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
crotamitonum crotamitone N-ethyl-o-crotonotoluidide crotonyl-N-ethyl-o-toluidine crotalgin crotamiton |
|
| id |
CHEBI:31439 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3 |
|
| inchikey |
DNTGGZPQPQTDQF-UHFFFAOYSA-N |
|
| label |
crotamiton |
|
| mass |
203.28020 |
|
| monoisotopicmass |
203.13101 |
|
| notation |
CHEBI:31439 |
|
| prefLabel |
crotamiton |
|
| RO_0000087 | ||
| smiles |
CCN(C(=O)C=CC)c1ccccc1C |
|
| subClassOf |