loading...| Preferred Name |
calcium glycerophosphate |
|
| Synonyms |
1,2,3-Propanetriol, mono(dihydrogen phosphate) calcium salt 1,2,3-Propanetriol, mono(dihydrogen phosphate), calcium salt calcium beta-glycerophosphate beta-glycerophosphoric acid calcium salt Calcium beta-glycerophosphate calcium 1,3-dihydroxypropan-2-yl phosphate Calcium Glycerophosphate |
|
| Definitions |
An organic calcium salt having glycerol 2-phosphate(2-) as the counterion. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31336 |
|
| alternative term |
1,2,3-Propanetriol, mono(dihydrogen phosphate) calcium salt 1,2,3-Propanetriol, mono(dihydrogen phosphate), calcium salt calcium beta-glycerophosphate beta-glycerophosphoric acid calcium salt Calcium beta-glycerophosphate calcium 1,3-dihydroxypropan-2-yl phosphate Calcium Glycerophosphate |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C12935 KEGG:D01488 Reaxys:3744916 CAS:27214-00-2 |
|
| definition |
An organic calcium salt having glycerol 2-phosphate(2-) as the counterion. |
|
| formula |
C3H7CaO6P |
|
| has part | ||
| has_exact_synonym |
calcium 1,3-dihydroxypropan-2-yl phosphate Calcium Glycerophosphate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,2,3-Propanetriol, mono(dihydrogen phosphate) calcium salt 1,2,3-Propanetriol, mono(dihydrogen phosphate), calcium salt calcium beta-glycerophosphate beta-glycerophosphoric acid calcium salt Calcium beta-glycerophosphate |
|
| id |
CHEBI:31336 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2 |
|
| inchikey |
UHHRFSOMMCWGSO-UHFFFAOYSA-L |
|
| label |
calcium glycerophosphate |
|
| mass |
210.13600 |
|
| monoisotopicmass |
209.96062 |
|
| notation |
CHEBI:31336 |
|
| overlaps | ||
| prefLabel |
calcium glycerophosphate |
|
| smiles |
[Ca++].OCC(CO)OP([O-])([O-])=O |
|
| subClassOf |