loading...| Preferred Name |
bethanechol chloride |
|
| Synonyms |
2-(carbamoyloxy)-N,N,N-trimethylpropan-1-aminium chloride trimethyl(2-carbamoyloxypropyl)ammonium chloride 2-carbamoyloxypropyltrimethylammonium chloride 2-((aminocarbonyl)oxy)-N,N,N-trimethyl-1-propanaminium chloride (2-hydroxypropyl)trimethylammonium chloride carbamate |
|
| Definitions |
The chloride salt of bethanechol. A slowly hydrolysed muscarinic agonist with no nicotinic effects, it is used to increase smooth muscle tone, as in the gastrointestinal tract following abdominal surgery, treatment of gastro-oesophageal reflux disease, and as an alternative to catheterisation in the treatment of non-obstructive urinary retention. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3085 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Bethanechol CAS:590-63-6 DrugBank:DB01019 KEGG:D01000 Patent:US2322375 Beilstein:3731819 Patent:US1894162 |
|
| definition |
The chloride salt of bethanechol. A slowly hydrolysed muscarinic agonist with no nicotinic effects, it is used to increase smooth muscle tone, as in the gastrointestinal tract following abdominal surgery, treatment of gastro-oesophageal reflux disease, and as an alternative to catheterisation in the treatment of non-obstructive urinary retention. |
|
| formula |
C7H17ClN2O2 |
|
| has part | ||
| has_exact_synonym |
2-(carbamoyloxy)-N,N,N-trimethylpropan-1-aminium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
trimethyl(2-carbamoyloxypropyl)ammonium chloride 2-carbamoyloxypropyltrimethylammonium chloride 2-((aminocarbonyl)oxy)-N,N,N-trimethyl-1-propanaminium chloride (2-hydroxypropyl)trimethylammonium chloride carbamate |
|
| id |
CHEBI:3085 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H16N2O2.ClH/c1-6(11-7(8)10)5-9(2,3)4;/h6H,5H2,1-4H3,(H-,8,10);1H |
|
| inchikey |
XXRMYXBSBOVVBH-UHFFFAOYSA-N |
|
| label |
bethanechol chloride |
|
| mass |
196.67500 |
|
| monoisotopicmass |
196.09786 |
|
| notation |
CHEBI:3085 |
|
| prefLabel |
bethanechol chloride |
|
| RO_0000087 | ||
| smiles |
[Cl-].CC(C[N+](C)(C)C)OC(N)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35273 |