loading...| Preferred Name | benazepril hydrochloride | |
| Synonyms |
benazepril HCl benazepril monohydrochloride Briem Cibace Cibacen Cibacene Labopol Lotensin Tensanil Zinadril [(3S)-3-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetic acid hydrochloride |
|
| Definitions |
A hydrochloride salt resulting from the reaction of benazepril with 1 mol eq. of hydrogen chloride. It is used as a prodrug for angiotensin-converting enzyme inhibitor benazeprilat in the treatment of hypertension and heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3012 |
|
| alternative term |
benazepril HCl benazepril monohydrochloride Briem Cibace Cibacen Cibacene Labopol Lotensin Tensanil Zinadril [(3S)-3-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetic acid hydrochloride |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:2853611 KEGG:C07701 PMID:26228576 Reaxys:4286047 PMID:22469039 CAS:86541-74-4 PMID:2264573 DrugBank:DB00542 KEGG:D00620 PMID:17984588 VSDB:1767 |
|
| definition |
A hydrochloride salt resulting from the reaction of benazepril with 1 mol eq. of hydrogen chloride. It is used as a prodrug for angiotensin-converting enzyme inhibitor benazeprilat in the treatment of hypertension and heart failure. |
|
| formula |
C24H29ClN2O5 |
|
| has part | ||
| has_exact_synonym |
[(3S)-3-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetic acid hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
benazepril HCl benazepril monohydrochloride Briem Cibace Cibacen Cibacene Labopol Lotensin Tensanil Zinadril |
|
| id |
CHEBI:3012 |
|
| in_subset | ||
| inchi |
InChI=1S/C24H28N2O5.ClH/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28;/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28);1H/t19-,20-;/m0./s1 |
|
| inchikey |
VPSRQEHTHIMDQM-FKLPMGAJSA-N |
|
| label |
benazepril hydrochloride |
|
| mass |
460.951 |
|
| monoisotopicmass |
460.17650 |
|
| notation |
CHEBI:3012 |
|
| overlaps | ||
| prefLabel |
benazepril hydrochloride |
|
| RO_0000087 | ||
| smiles |
C1C=2C(N(C([C@](C1)(N[C@H](C(=O)OCC)CCC3=CC=CC=C3)[H])=O)CC(O)=O)=CC=CC2.Cl |
|
| subClassOf |