Preferred Name |
nerol |
|
Synonyms |
(2Z)-3,7-dimethylocta-2,6-dien-1-ol Nerol nerol neryl alcohol (Z)-3,7-dimethyl-2,6-octadien-1-ol 2-cis-3,7-dimethyl-2,6-octadien-1-ol cis-3,7-dimethyl-2,6-octadien-1-ol (Z)-3,7-Dimethylocta-2,6-dien-1-ol (2Z)-3,7-dimethyl-2,6-octadien-1-ol (Z)-geraniol cis-geraniol |
|
Definitions |
The (2Z)-stereoisomer of 3,7-dimethylocta-2,6-dien-1-ol. It has been isolated from the essential oils from plants like lemon grass. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_29452 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:1722454 LIPID_MAPS_instance:LMPR0102010010 KEGG:C09871 Patent:CN103342627 CAS:106-25-2 MetaCyc:CPD-7978 KNApSAcK:C00000855 Wikipedia:Nerol PMID:24269775 Patent:MX2013000640 PMID:24599108 Beilstein:1722454 Beilstein:1722455 PMID:23999034 |
|
definition |
The (2Z)-stereoisomer of 3,7-dimethylocta-2,6-dien-1-ol. It has been isolated from the essential oils from plants like lemon grass. |
|
formula |
C10H18O |
|
has_alternative_id |
CHEBI:24220 CHEBI:7523 |
|
has_exact_synonym |
(2Z)-3,7-dimethylocta-2,6-dien-1-ol Nerol nerol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
neryl alcohol (Z)-3,7-dimethyl-2,6-octadien-1-ol 2-cis-3,7-dimethyl-2,6-octadien-1-ol cis-3,7-dimethyl-2,6-octadien-1-ol (Z)-3,7-Dimethylocta-2,6-dien-1-ol (2Z)-3,7-dimethyl-2,6-octadien-1-ol (Z)-geraniol cis-geraniol |
|
id |
CHEBI:29452 |
|
in_subset | ||
inchi |
InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
|
inchikey |
GLZPCOQZEFWAFX-YFHOEESVSA-N |
|
label |
nerol |
|
mass |
154.250 |
|
monoisotopicmass |
154.13577 |
|
notation |
CHEBI:29452 |
|
prefLabel |
nerol |
|
RO_0000087 | ||
smiles |
C(=C\CO)(\CCC=C(C)C)/C |
|
subClassOf |