loading...| Preferred Name |
(2,4,5-trichlorophenoxy)acetic acid |
|
| Synonyms |
(2,4,5-trichlorophenoxy)acetic acid (2,4,5-Trichlorphenoxy)essigsaeure 2,4,5-Trichlorphenoxyessigsaeure Esteron 245 2,4,5-Trichlorophenoxyacetic acid 2,4,5-T Trioxone |
|
| Definitions |
A chlorophenoxyacetic acid that is phenoxyacetic acid in which the ring hydrogens at postions 2, 4 and 5 are substituted by chlorines. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27903 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:2055620 Gmelin:434052 PMID:23085749 Wikipedia:2,4,5-Trichlorophenoxyacetic_acid KEGG:C07100 PMID:23167922 Beilstein:2055620 LINCS:LSM-24946 MetaCyc:CPD-10896 CAS:93-76-5 Pesticides:2,4,5-t PPDB:1532 |
|
| definition |
A chlorophenoxyacetic acid that is phenoxyacetic acid in which the ring hydrogens at postions 2, 4 and 5 are substituted by chlorines. |
|
| formula |
C8H5Cl3O3 |
|
| has_alternative_id |
CHEBI:897 |
|
| has_exact_synonym |
(2,4,5-trichlorophenoxy)acetic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(2,4,5-Trichlorphenoxy)essigsaeure 2,4,5-Trichlorphenoxyessigsaeure Esteron 245 2,4,5-Trichlorophenoxyacetic acid 2,4,5-T Trioxone |
|
| id |
CHEBI:27903 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13) |
|
| inchikey |
SMYMJHWAQXWPDB-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
(2,4,5-trichlorophenoxy)acetic acid |
|
| mass |
255.48160 |
|
| monoisotopicmass |
253.93043 |
|
| notation |
CHEBI:27903 |
|
| prefLabel |
(2,4,5-trichlorophenoxy)acetic acid |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_23582 |
|
| smiles |
OC(=O)COc1cc(Cl)c(Cl)cc1Cl |
|
| subClassOf |