Preferred Name |
acetohydroxamic acid |
|
Synonyms |
Acetohydroxamic acid ACETOHYDROXAMIC ACID N-hydroxyacetamide acide acetohydroxamique acidum acetohydroxamicum acido acetohidroxamico N-Acetyl hydroxyacetamide Methylhydroxamic acid N-Hydroxyacetamide Acethydroxamsaeure Acethydroxamsaure Acetylhydroxamic acid Cetohyroxamic acid N-Acetylhydroxylamine acetohydroxamic acid Acetic acid, oxime AHA Lithostat |
|
Definitions |
A member of the class of acetohydroxamic acids that is acetamide in which one of the amino hydrogens has been replaced by a hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27777 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Acetohydroxamic_Acid KEGG:D00220 KEGG:C06808 CAS:546-88-3 PDBeChem:HAE DrugBank:DB00551 Drug_Central:58 Beilstein:1739019 |
|
definition |
A member of the class of acetohydroxamic acids that is acetamide in which one of the amino hydrogens has been replaced by a hydroxy group. |
|
formula |
C2H5NO2 |
|
has_alternative_id |
CHEBI:22176 CHEBI:43006 CHEBI:2396 |
|
has_exact_synonym |
Acetohydroxamic acid ACETOHYDROXAMIC ACID N-hydroxyacetamide |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
acide acetohydroxamique acidum acetohydroxamicum acido acetohidroxamico N-Acetyl hydroxyacetamide Methylhydroxamic acid N-Hydroxyacetamide Acethydroxamsaeure Acethydroxamsaure Acetylhydroxamic acid Cetohyroxamic acid N-Acetylhydroxylamine acetohydroxamic acid Acetic acid, oxime AHA Lithostat |
|
id |
CHEBI:27777 |
|
in_subset | ||
inchi |
InChI=1S/C2H5NO2/c1-2(4)3-5/h5H,1H3,(H,3,4) |
|
inchikey |
RRUDCFGSUDOHDG-UHFFFAOYSA-N |
|
is_tautomer_of | ||
label |
acetohydroxamic acid |
|
mass |
75.06664 |
|
monoisotopicmass |
75.03203 |
|
notation |
CHEBI:27777 |
|
prefLabel |
acetohydroxamic acid |
|
RO_0000087 | ||
smiles |
CC(=O)NO |
|
subClassOf |