loading...| Preferred Name |
ambenonium |
|
| Synonyms |
2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] Ambenonium Ambenonium Base Ambenonum |
|
| Definitions |
A symmetrical oxalamide-based bis-quaternary ammonium ion having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2627 |
|
| charge |
+2 |
|
| database_cross_reference |
DrugBank:DB01122 KEGG:C07773 Drug_Central:146 CAS:7648-98-8 Wikipedia:Ambenonium Beilstein:4168740 |
|
| definition |
A symmetrical oxalamide-based bis-quaternary ammonium ion having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
|
| formula |
C28H42Cl2N4O2 |
|
| has_exact_synonym |
2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] Ambenonium |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Ambenonium Base Ambenonum |
|
| id |
CHEBI:2627 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H40Cl2N4O2/c1-5-33(6-2,21-23-13-9-11-15-25(23)29)19-17-31-27(35)28(36)32-18-20-34(7-3,8-4)22-24-14-10-12-16-26(24)30/h9-16H,5-8,17-22H2,1-4H3/p+2 |
|
| inchikey |
OMHBPUNFVFNHJK-UHFFFAOYSA-P |
|
| label |
ambenonium |
|
| mass |
537.56500 |
|
| monoisotopicmass |
536.26738 |
|
| notation |
CHEBI:2627 |
|
| prefLabel |
ambenonium |
|
| RO_0000087 | ||
| smiles |
CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc1ccccc1Cl |
|
| subClassOf |