Jump to:
loading...| Preferred Name | p-menthan-3-ol | |
| Synonyms |
|
|
| Definitions |
Any secondary alcohol that is one of the eight possible diastereoisomers of 5-methyl-2-(propan-2-yl)cyclohexan-1-ol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25187 |
|
| bearer of | ||
| charge |
0 |
|
| definition |
Any secondary alcohol that is one of the eight possible diastereoisomers of 5-methyl-2-(propan-2-yl)cyclohexan-1-ol. |
|
| formula |
C10H20O |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:25187 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3 |
|
| inchikey |
NOOLISFMXDJSKH-UHFFFAOYSA-N |
|
| label |
p-menthan-3-ol |
|
| mass |
156.26520 |
|
| monoisotopicmass |
156.15142 |
|
| notation |
CHEBI:25187 |
|
| prefLabel |
p-menthan-3-ol |
|
| RO_0000087 | ||
| smiles |
CC(C)C1CCC(C)CC1O |
|
| subClassOf |
Create mapping