Preferred Name |
abacavir sulfate |
|
Synonyms |
bis({(1S,4R)-4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]cyclopent-2-en-1-yl}methanol) sulfate Abacavir sulfate |
|
Definitions |
An azaheterocycle sulfate salt that is the sulfate salt of the HIV-1 reverse transcriptase inhibitor abacavir. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2361 |
|
charge |
0 |
|
database_cross_reference |
PMID:11366289 PMID:24751900 PMID:21648134 Patent:WO2004089952 KEGG:D00891 PMID:11082806 PMID:17541065 PMID:23264939 PMID:20575592 CAS:188062-50-2 Patent:AU2003242983 Patent:JP2010189419 |
|
definition |
An azaheterocycle sulfate salt that is the sulfate salt of the HIV-1 reverse transcriptase inhibitor abacavir. |
|
formula |
2C14H18N6O.H2O4S |
|
has_exact_synonym |
bis({(1S,4R)-4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]cyclopent-2-en-1-yl}methanol) sulfate Abacavir sulfate |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:2361 |
|
in_subset | ||
inchi |
InChI=1S/2C14H18N6O.H2O4S/c2*15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21;1-5(2,3)4/h2*1,4,7-10,21H,2-3,5-6H2,(H3,15,17,18,19);(H2,1,2,3,4)/t2*8-,10+;/m11./s1 |
|
inchikey |
WMHSRBZIJNQHKT-FFKFEZPRSA-N |
|
label |
abacavir sulfate |
|
mass |
670.74460 |
|
monoisotopicmass |
670.27580 |
|
notation |
CHEBI:2361 |
|
prefLabel |
abacavir sulfate |
|
smiles |
OS(O)(=O)=O.Nc1nc(NC2CC2)c2ncn([C@@H]3C[C@H](CO)C=C3)c2n1.Nc1nc(NC2CC2)c2ncn([C@@H]3C[C@H](CO)C=C3)c2n1 |
|
subClassOf |