loading...| Preferred Name |
5-methoxytryptamine |
|
| Synonyms |
5-Methoxytryptamine 2-(5-methoxy-1H-indol-3-yl)ethanamine 3-(2-aminoethyl)-5-methoxyindole 5-methoxy-1H-indole-3-ethanamine 2-(5-methoxyindol-3-yl)ethylamine O-methylserotonin 5-MT 5-MeOT 5-Mot 5MOT mexamine |
|
| Definitions |
A member of the class of tryptamines that is the methyl ether derivative of serotonin. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2089 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:17451889 PMID:16007002 Reaxys:145587 FooDB:FDB023311 Wikipedia:5-Methoxytryptamine PMID:3919158 PMID:22678752 PMID:9128844 KEGG:C05659 PMID:17601618 Patent:EP1653948 PMID:23098818 PMID:10420441 PDBeChem:F5U LINCS:LSM-4582 PMID:16714247 PMID:23451999 Patent:WO2005009419 Beilstein:145587 KNApSAcK:C00051985 CAS:608-07-1 PMID:27112772 PMID:18318189 PMID:12659894 Gmelin:1220927 HMDB:HMDB0004095 PMID:25863630 Chemspider:1767 PMID:11270479 |
|
| definition |
A member of the class of tryptamines that is the methyl ether derivative of serotonin. |
|
| formula |
C11H14N2O |
|
| has_exact_synonym |
5-Methoxytryptamine 2-(5-methoxy-1H-indol-3-yl)ethanamine |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(2-aminoethyl)-5-methoxyindole 5-methoxy-1H-indole-3-ethanamine 2-(5-methoxyindol-3-yl)ethylamine O-methylserotonin 5-MT 5-MeOT 5-Mot 5MOT mexamine |
|
| id |
CHEBI:2089 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 |
|
| inchikey |
JTEJPPKMYBDEMY-UHFFFAOYSA-N |
|
| is_conjugate_base_of | ||
| label |
5-methoxytryptamine |
|
| mass |
190.246 |
|
| monoisotopicmass |
190.11061 |
|
| notation |
CHEBI:2089 |
|
| prefLabel |
5-methoxytryptamine |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_77307 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_66987 http://purl.obolibrary.org/obo/CHEBI_35941 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_142184 http://purl.obolibrary.org/obo/CHEBI_142185 |
|
| smiles |
COC1=CC2=C(NC=C2CCN)C=C1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |