Preferred Name |
(2,4,5-trichlorophenoxy)acetate |
|
Synonyms |
(2,4,5-trichlorophenoxy)acetate 2,4,5-trichlorophenoxyacetate |
|
Definitions |
A chlorophenoxyacetate anion obtained by deprotonation of the carboxy group of (2,4,5-trichlorophenoxy)acetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_19331 |
|
charge |
-1 |
|
database_cross_reference |
UM-BBD_compID:c0361 Gmelin:434053 MetaCyc:CPD-10896 |
|
definition |
A chlorophenoxyacetate anion obtained by deprotonation of the carboxy group of (2,4,5-trichlorophenoxy)acetic acid. |
|
formula |
C8H4Cl3O3 |
|
has_exact_synonym |
(2,4,5-trichlorophenoxy)acetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2,4,5-trichlorophenoxyacetate |
|
id |
CHEBI:19331 |
|
in_subset | ||
inchi |
InChI=1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13)/p-1 |
|
inchikey |
SMYMJHWAQXWPDB-UHFFFAOYSA-M |
|
is_conjugate_base_of | ||
label |
(2,4,5-trichlorophenoxy)acetate |
|
mass |
254.47366 |
|
monoisotopicmass |
252.92315 |
|
notation |
CHEBI:19331 |
|
prefLabel |
(2,4,5-trichlorophenoxy)acetate |
|
smiles |
[O-]C(=O)COc1cc(Cl)c(Cl)cc1Cl |
|
subClassOf |
Create mapping