loading...| Preferred Name | 3,3',5-triiodo-L-thyronine | |
| Synonyms |
4-(4-hydroxy-3-iodophenoxy)-3,5-diiodo-L-phenylalanine liothyronine O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine liothyroninum L-3,5,3'-Triiodothyronine Triiodothyronine 3,5,3'-Triiodothyronine 3,5,3'TRIIODOTHYRONINE Liothyronine 3,5,3'-Triiodo-L-thyronine liotironina L-T3 T3 Tertroxin Tresitope 3,3',5-triiodo-L-thyronine |
|
| Definitions |
An iodothyronine compound having iodo substituents at the 3-, 3'- and 5-positions. Although some is produced in the thyroid, most of the 3,3',5-triiodo-L-thyronine in the body is generated by mono-deiodination of L-thyroxine in the peripheral tissues. Its metabolic activity is about 3 to 5 times that of L-thyroxine. The sodium salt is used in the treatment of hypothyroidism. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18258 |
|
| alternative term |
4-(4-hydroxy-3-iodophenoxy)-3,5-diiodo-L-phenylalanine liothyronine O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine liothyroninum L-3,5,3'-Triiodothyronine Triiodothyronine 3,5,3'-Triiodothyronine 3,5,3'TRIIODOTHYRONINE Liothyronine 3,5,3'-Triiodo-L-thyronine liotironina L-T3 T3 Tertroxin Tresitope 3,3',5-triiodo-L-thyronine |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_60311 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00279 MetaCyc:CPD-10813 KEGG:D08128 PMID:15206581 LINCS:LSM-3991 Beilstein:2710227 CAS:6893-02-3 Wikipedia:Triiodothyronine KEGG:C02465 PMID:19339791 Drug_Central:1585 PMID:11738632 Reaxys:2710227 HMDB:HMDB0000265 PDBeChem:T3 |
|
| definition |
An iodothyronine compound having iodo substituents at the 3-, 3'- and 5-positions. Although some is produced in the thyroid, most of the 3,3',5-triiodo-L-thyronine in the body is generated by mono-deiodination of L-thyroxine in the peripheral tissues. Its metabolic activity is about 3 to 5 times that of L-thyroxine. The sodium salt is used in the treatment of hypothyroidism. |
|
| formula |
C15H12I3NO4 |
|
| has_alternative_id |
CHEBI:13059 CHEBI:45840 CHEBI:11701 CHEBI:11702 CHEBI:19894 CHEBI:9722 |
|
| has_exact_synonym |
3,3',5-triiodo-L-thyronine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-(4-hydroxy-3-iodophenoxy)-3,5-diiodo-L-phenylalanine liothyronine O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine liothyroninum L-3,5,3'-Triiodothyronine Triiodothyronine 3,5,3'-Triiodothyronine 3,5,3'TRIIODOTHYRONINE Liothyronine 3,5,3'-Triiodo-L-thyronine liotironina L-T3 T3 Tertroxin Tresitope |
|
| id |
CHEBI:18258 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1 |
|
| inchikey |
AUYYCJSJGJYCDS-LBPRGKRZSA-N |
|
| is_conjugate_acid_of | ||
| is_tautomer_of | ||
| label |
3,3',5-triiodo-L-thyronine |
|
| mass |
650.97350 |
|
| monoisotopicmass |
650.79004 |
|
| notation |
CHEBI:18258 |
|
| prefLabel |
3,3',5-triiodo-L-thyronine |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_60311 |
|
| smiles |
N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24864 |