loading...| Preferred Name | phytol | |
| Synonyms |
trans-Phytol (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-ol (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol Phytol phytol |
|
| Definitions |
A diterpenoid that is hexadec-2-en-1-ol substituted by methyl groups at positions 3, 7, 11 and 15. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17327 |
|
| alternative term |
trans-Phytol (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-ol (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol Phytol phytol |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24333358 MetaCyc:PHYTOL KEGG:C01389 CAS:150-86-7 CAS:7541-49-3 PMID:24392173 LIPID_MAPS_instance:LMPR0104010002 HMDB:HMDB0002019 KNApSAcK:C00003467 PMID:24422895 PMID:17015885 Reaxys:7855349 |
|
| definition |
A diterpenoid that is hexadec-2-en-1-ol substituted by methyl groups at positions 3, 7, 11 and 15. |
|
| formula |
C20H40O |
|
| has_alternative_id |
CHEBI:14836 CHEBI:26121 CHEBI:8193 |
|
| has_exact_synonym |
(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol Phytol phytol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
trans-Phytol (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-ol |
|
| id |
CHEBI:17327 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
|
| inchikey |
BOTWFXYSPFMFNR-PYDDKJGSSA-N |
|
| label |
phytol |
|
| mass |
296.53100 |
|
| monoisotopicmass |
296.30792 |
|
| notation |
CHEBI:17327 |
|
| prefLabel |
phytol |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| smiles |
CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC\C(C)=C\CO |
|
| subClassOf |