Preferred Name |
2-hydroxyethyl octadecanoate |
|
Synonyms |
2-hydroxyethyl octadecanoate Empilan 2848 Prodhybase ethyl octadecanoic acid 2-hydroxyethyl ester Prodhybas N Emerest 2350 Clindrol SEG glycol stearate glycol monostearate octadecanoic acid, 2-hydroxyethyl ester ethylene glycol stearate 2-hydroxyethyl stearate ethylene glycol monostearate stearic acid, monoester with ethylene glycol Ivorit Lipo EGMS Monthybase Monthyle Parastarin S 151 Sedetol USAF KE-11 |
|
Definitions |
An octadecanoate ester obtained by formal condensation between the carboxy group of octadecanoic (stearic) acid and one of the hydroxy groups of ethylene glycol. It is an ingredient in many personal care products and cosmetics. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_167626 |
|
charge |
0 |
|
database_cross_reference |
CAS:111-60-4 Wikipedia:Glycol_stearate PMID:32353654 Chemspider:23148 Reaxys:1794033 PMID:32499766 |
|
definition |
An octadecanoate ester obtained by formal condensation between the carboxy group of octadecanoic (stearic) acid and one of the hydroxy groups of ethylene glycol. It is an ingredient in many personal care products and cosmetics. |
|
formula |
C20H40O3 |
|
has_exact_synonym |
2-hydroxyethyl octadecanoate |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Empilan 2848 Prodhybase ethyl octadecanoic acid 2-hydroxyethyl ester Prodhybas N Emerest 2350 Clindrol SEG glycol stearate glycol monostearate octadecanoic acid, 2-hydroxyethyl ester ethylene glycol stearate 2-hydroxyethyl stearate ethylene glycol monostearate stearic acid, monoester with ethylene glycol Ivorit Lipo EGMS Monthybase Monthyle Parastarin S 151 Sedetol USAF KE-11 |
|
id |
CHEBI:167626 |
|
in_subset | ||
inchi |
InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3 |
|
inchikey |
RFVNOJDQRGSOEL-UHFFFAOYSA-N |
|
label |
2-hydroxyethyl octadecanoate |
|
mass |
328.537 |
|
monoisotopicmass |
328.29775 |
|
notation |
CHEBI:167626 |
|
prefLabel |
2-hydroxyethyl octadecanoate |
|
RO_0000087 | ||
smiles |
CCCCCCCCCCCCCCCCCC(=O)OCCO |
|
subClassOf |
Delete | Mapping To | Ontology | Source |
---|---|---|---|
http://purl.obolibrary.org/obo/CHEBI_167626 | CHEBI | SAME_URI | |
http://purl.obolibrary.org/obo/CHEBI_167626 | PDRO | SAME_URI | |
http://purl.obolibrary.org/obo/CHEBI_167626 | DRON | SAME_URI | |
http://purl.obolibrary.org/obo/CHEBI_167626 | CHEBI | LOOM | |
http://purl.obolibrary.org/obo/CHEBI_167626 | PDRO | LOOM |