loading...| Preferred Name | 4-hydroxybutyrate | |
| Synonyms |
4-hydroxybutanoate gamma-hydroxybutyrate GHB |
|
| Definitions |
A 4-hydroxy monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of 4-hydroxybutyric acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16724 |
|
| alternative term |
4-hydroxybutanoate gamma-hydroxybutyrate GHB |
|
| bearer of | ||
| charge |
-1 |
|
| database_cross_reference |
Gmelin:1524032 UM-BBD_compID:c0022 DrugBank:DB01440 KEGG:C00989 Beilstein:3903887 |
|
| definition |
A 4-hydroxy monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of 4-hydroxybutyric acid. |
|
| formula |
C4H7O3 |
|
| has_alternative_id |
CHEBI:12006 CHEBI:20401 |
|
| has_exact_synonym |
4-hydroxybutanoate |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-hydroxybutanoate gamma-hydroxybutyrate GHB |
|
| id |
CHEBI:16724 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1 |
|
| inchikey |
SJZRECIVHVDYJC-UHFFFAOYSA-M |
|
| is_conjugate_acid_of | ||
| label |
4-hydroxybutyrate |
|
| mass |
103.09658 |
|
| monoisotopicmass |
103.04007 |
|
| notation |
CHEBI:16724 |
|
| prefLabel |
4-hydroxybutyrate |
|
| RO_0000087 | ||
| smiles |
OCCCC([O-])=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_58951 |