loading...| Preferred Name |
triclosan |
|
| Synonyms |
5-chloro-2-(2,4-dichlorophenoxy)phenol Triclosan triclosanum 2,4,4'-Trichloro-2'-hydroxydiphenyl ether 5-Chloro-2-(2,4-dichloro-phenoxy)-phenol triclosan |
|
| Definitions |
An aromatic ether that is phenol which is substituted at C-5 by a chloro group and at C-2 by a 2,4-dichlorophenoxy group. It is widely used as a preservative and antimicrobial agent in personal care products such as soaps, skin creams, toothpaste and deodorants as well as in household items such as plastic chopping boards, sports equipment and shoes. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_164200 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:28741979 PMID:23791346 PMID:29030459 PMID:23927454 PMID:29232866 PMID:29111213 PMID:23192912 PMID:23648333 PMID:23561013 PMID:19388793 PMID:29067681 PMID:21094257 PMID:22561896 PMID:29131715 Wikipedia:Triclosan PMID:25179274 PMID:18837732 PMID:18937596 PMID:21166831 Beilstein:2057142 PMID:23435526 PMID:24079913 LINCS:LSM-2929 PMID:29100157 DrugBank:DB08604 Patent:NL6401526 PMID:23161706 PMID:11175846 KEGG:D06226 PDBeChem:TCL KEGG:C12059 PMID:23890965 PMID:29205483 Patent:US3506720 PMID:29348637 PMID:29172042 Drug_Central:3631 PMID:29214481 CAS:3380-34-5 PMID:28236114 PMID:22105314 PMID:23313217 PMID:23831729 PMID:29175687 PMID:28632490 PMID:29111444 PMID:29332277 PMID:23320506 PMID:23614034 Patent:US3629477 PMID:28339349 Reaxys:2057142 PMID:17567585 PMID:21833630 PMID:23282071 PMID:29277667 PMID:23146048 PMID:11418506 PMID:29340711 PMID:22746545 PMID:15269185 PMID:29109308 PMID:23368947 PMID:23592331 PMID:29197580 PMID:29150338 PMID:29154092 |
|
| definition |
An aromatic ether that is phenol which is substituted at C-5 by a chloro group and at C-2 by a 2,4-dichlorophenoxy group. It is widely used as a preservative and antimicrobial agent in personal care products such as soaps, skin creams, toothpaste and deodorants as well as in household items such as plastic chopping boards, sports equipment and shoes. |
|
| formula |
C12H7Cl3O2 |
|
| has_alternative_id |
CHEBI:47700 CHEBI:29697 |
|
| has_exact_synonym |
5-chloro-2-(2,4-dichlorophenoxy)phenol Triclosan |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
triclosanum 2,4,4'-Trichloro-2'-hydroxydiphenyl ether 5-Chloro-2-(2,4-dichloro-phenoxy)-phenol triclosan |
|
| id |
CHEBI:164200 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H |
|
| inchikey |
XEFQLINVKFYRCS-UHFFFAOYSA-N |
|
| label |
triclosan |
|
| mass |
289.54200 |
|
| monoisotopicmass |
287.95116 |
|
| notation |
CHEBI:164200 |
|
| prefLabel |
triclosan |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_24127 http://purl.obolibrary.org/obo/CHEBI_50683 http://purl.obolibrary.org/obo/CHEBI_77853 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_139512 |
|
| smiles |
Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_83403 |