Preferred Name |
enoxacin |
|
Synonyms |
1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid ENOXACIN Enoxacin 1-Ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-1,8-naphthyridine-3-carboxylic acid enoxacin enoxacine enoxacino enoxacinum |
|
Definitions |
A 1,8-naphthyridine derivative that is 1,4-dihydro-1,8-naphthyridine with an ethyl group at the 1 position, a carboxy group at the 3-position, an oxo sustituent at the 4-position, a fluoro substituent at the 5-position and a piperazin-1-yl group at the 7 position. An antibacterial, it is used in the treatment of urinary-tract infections and gonorrhoea. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_157175 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Enoxacin CAS:74011-58-8 DrugBank:DB00467 PMID:16644219 Patent:US4352803 Beilstein:3628995 Drug_Central:1013 Patent:US4359578 KEGG:C06979 LINCS:LSM-5848 Patent:EP9425 PMID:8741236 Reaxys:3628995 KEGG:D00310 VSDB:1896 |
|
definition |
A 1,8-naphthyridine derivative that is 1,4-dihydro-1,8-naphthyridine with an ethyl group at the 1 position, a carboxy group at the 3-position, an oxo sustituent at the 4-position, a fluoro substituent at the 5-position and a piperazin-1-yl group at the 7 position. An antibacterial, it is used in the treatment of urinary-tract infections and gonorrhoea. |
|
formula |
C15H17FN4O3 |
|
has_alternative_id |
CHEBI:4796 |
|
has_exact_synonym |
1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid ENOXACIN Enoxacin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1-Ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-1,8-naphthyridine-3-carboxylic acid enoxacin enoxacine enoxacino enoxacinum |
|
id |
CHEBI:157175 |
|
in_subset | ||
inchi |
InChI=1S/C15H17FN4O3/c1-2-19-8-10(15(22)23)12(21)9-7-11(16)14(18-13(9)19)20-5-3-17-4-6-20/h7-8,17H,2-6H2,1H3,(H,22,23) |
|
inchikey |
IDYZIJYBMGIQMJ-UHFFFAOYSA-N |
|
label |
enoxacin |
|
mass |
320.31890 |
|
monoisotopicmass |
320.12847 |
|
notation |
CHEBI:157175 |
|
prefLabel |
enoxacin |
|
RO_0000087 | ||
smiles |
CCn1cc(C(O)=O)c(=O)c2cc(F)c(nc12)N1CCNCC1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_73537 http://purl.obolibrary.org/obo/CHEBI_87211 http://purl.obolibrary.org/obo/CHEBI_33709 http://purl.obolibrary.org/obo/CHEBI_46848 |