loading...| Preferred Name |
ammonium persulfate |
|
| Synonyms |
diammonium [(sulfonatoperoxy)sulfonyl]oxidanide Ammonium peroxydisulfate Diammonium peroxydisulfate Persulfate d'ammonium Diammonium persulfate Peroxydisulfuric acid, diammonium salt APS |
|
| Definitions |
An inorganic ammonium salt in which two of the terminal hydroxy groups of peroxydisulfuric acid are deprotonated and associated with ammonium ions as counter-cations. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_156543 |
|
| charge |
0 |
|
| database_cross_reference |
AGR:IND605702063 PMID:32290121 PMID:31826514 PMID:32933679 PMID:28753999 CAS:7727-54-0 PMID:32785935 PMID:30832861 Wikipedia:Ammonium_persulfate AGR:IND606309199 PMID:31879107 PMID:28924225 AGR:IND606761306 |
|
| definition |
An inorganic ammonium salt in which two of the terminal hydroxy groups of peroxydisulfuric acid are deprotonated and associated with ammonium ions as counter-cations. |
|
| formula |
O6S2.H4N.H4N |
|
| has part | ||
| has_exact_synonym |
diammonium [(sulfonatoperoxy)sulfonyl]oxidanide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Ammonium peroxydisulfate Diammonium peroxydisulfate Persulfate d'ammonium Diammonium persulfate Peroxydisulfuric acid, diammonium salt APS |
|
| id |
CHEBI:156543 |
|
| in_subset | ||
| inchi |
InChI=1S/2H3N.H2O6S2/c;;1-7(2)5-6-8(3)4/h2*1H3;(H,1,2)(H,3,4) |
|
| inchikey |
VAZSKTXWXKYQJF-UHFFFAOYSA-N |
|
| label |
ammonium persulfate |
|
| mass |
196.190 |
|
| monoisotopicmass |
195.98238 |
|
| notation |
CHEBI:156543 |
|
| prefLabel |
ammonium persulfate |
|
| RO_0000087 | ||
| smiles |
[NH4+].[NH4+].[O-]S(=O)OOS([O-])=O |
|
| subClassOf |