Link to this page
Biological and Environmental Research Ontology
Last uploaded:
December 23, 2022
Jump to:
| Preferred Name | prostaglandin F2alpha | |
| Synonyms |
Prostaglandin F2a (+)-Prostaglandin F2a Prostin F 2 alpha dinoprostum 9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid (5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate l-Prostaglandin F2-alpha l-PGF2-alpha 9a,11a-PGF2 7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid Enzaprost F Amoglandin Cyclosin Dinoprost Enzaprost PGF2a PGF2alpha Panacelan Protamodin U 14583 dinoprost dinoprosta (5Z,13E,15S)-9alpha,11alpha,15-trihydroxyprosta-5,13-dien-1-oic acid Prostaglandin F2alpha |
|
| Definitions |
A prostaglandins Falpha that is prosta-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9, 11 and 15. It is a naturally occurring prostaglandin used to induce labor. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15553 |
|
| alternative term |
Prostaglandin F2a (+)-Prostaglandin F2a Prostin F 2 alpha dinoprostum 9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid (5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate l-Prostaglandin F2-alpha l-PGF2-alpha 9a,11a-PGF2 7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid Enzaprost F Amoglandin Cyclosin Dinoprost Enzaprost PGF2a PGF2alpha Panacelan Protamodin U 14583 dinoprost dinoprosta (5Z,13E,15S)-9alpha,11alpha,15-trihydroxyprosta-5,13-dien-1-oic acid Prostaglandin F2alpha
|
|
| bearer of | ||
| charge |
0
|
|
| database_cross_reference |
Wikipedia:Dinoprost MetaCyc:5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY HMDB:HMDB0001139 KEGG:D00081 Beilstein:2225571 PMID:11438482 KEGG:C00639 Drug_Central:912 CAS:551-11-1 PMID:23807981 Reaxys:2225571 LIPID_MAPS_instance:LMFA03010002 VSDB:1803
|
|
| definition |
A prostaglandins Falpha that is prosta-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9, 11 and 15. It is a naturally occurring prostaglandin used to induce labor.
|
|
| formula |
C20H34O5
|
|
| has_alternative_id |
CHEBI:10913 CHEBI:26327 CHEBI:8516
|
|
| has_exact_synonym |
(5Z,13E,15S)-9alpha,11alpha,15-trihydroxyprosta-5,13-dien-1-oic acid Prostaglandin F2alpha
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
Prostaglandin F2a (+)-Prostaglandin F2a Prostin F 2 alpha dinoprostum 9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid (5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate l-Prostaglandin F2-alpha l-PGF2-alpha 9a,11a-PGF2 7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid Enzaprost F Amoglandin Cyclosin Dinoprost Enzaprost PGF2a PGF2alpha Panacelan Protamodin U 14583 dinoprost dinoprosta
|
|
| id |
CHEBI:15553
|
|
| in_subset | ||
| inchi |
InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1
|
|
| inchikey |
PXGPLTODNUVGFL-YNNPMVKQSA-N
|
|
| is_conjugate_acid_of | ||
| label |
prostaglandin F2alpha
|
|
| mass |
354.48100
|
|
| monoisotopicmass |
354.24062
|
|
| notation |
CHEBI:15553
|
|
| prefLabel |
prostaglandin F2alpha
|
|
| RO_0000087 | ||
| smiles |
CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)C[C@H](O)[C@@H]1C\C=C/CCCC(O)=O
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping