loading...| Preferred Name | glasdegib | |
| Synonyms |
N-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-N'-(4-cyanophenyl)urea glasdegibum PF-04449913 Daurismo PF-4449913 PF-913 glasdegib 1-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-cyanophenyl)urea |
|
| Definitions |
A member of the class of benzimidazoles that is 1H-benzimidazole which is substituted by a (2R,4S)-4-{[(4-cyanophenyl)carbamoyl]amino}-1-methylpiperidin-2-yl group at position 2. It is a hedgehog signalling pathway inhibitor that acts by binding to Smoothened (SMO) receptors and blocking signal transduction (IC50 = 5 nM). It is used in combination with low-dose cytarabine, for the treatment of newly-diagnosed acute myeloid leukemia (AML) in adult patients (aged >= 75 years), or who have medical conditions that prevent the use of standard chemotherapy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_145428 |
|
| alternative term |
N-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-N'-(4-cyanophenyl)urea glasdegibum PF-04449913 Daurismo PF-4449913 PF-913 glasdegib 1-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-cyanophenyl)urea |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:31516032 PMID:24900436 PMID:30666593 PMID:25388167 Wikipedia:Glasdegib DrugBank:DB11978 LINCS:LSM-45612 PMID:24944041 PMID:29086063 PMID:30555165 PMID:27486815 CAS:1095173-27-5 PMID:29463550 PMID:31584572 PMID:27866461 PMID:31064779 PMID:30536154 PMID:31432695 KEGG:D10636 PMID:29488303 PMID:28556364 PMID:26688487 PMID:30849661 PMID:31030089 PMID:30977980 PMID:30074259 |
|
| definition |
A member of the class of benzimidazoles that is 1H-benzimidazole which is substituted by a (2R,4S)-4-{[(4-cyanophenyl)carbamoyl]amino}-1-methylpiperidin-2-yl group at position 2. It is a hedgehog signalling pathway inhibitor that acts by binding to Smoothened (SMO) receptors and blocking signal transduction (IC50 = 5 nM). It is used in combination with low-dose cytarabine, for the treatment of newly-diagnosed acute myeloid leukemia (AML) in adult patients (aged >= 75 years), or who have medical conditions that prevent the use of standard chemotherapy. |
|
| formula |
C21H22N6O |
|
| has_exact_synonym |
1-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-cyanophenyl)urea |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-N'-(4-cyanophenyl)urea glasdegibum PF-04449913 Daurismo PF-4449913 PF-913 glasdegib |
|
| id |
CHEBI:145428 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H22N6O/c1-27-11-10-16(24-21(28)23-15-8-6-14(13-22)7-9-15)12-19(27)20-25-17-4-2-3-5-18(17)26-20/h2-9,16,19H,10-12H2,1H3,(H,25,26)(H2,23,24,28)/t16-,19-/m1/s1 |
|
| inchikey |
SFNSLLSYNZWZQG-VQIMIIECSA-N |
|
| label |
glasdegib |
|
| mass |
374.448 |
|
| monoisotopicmass |
374.18551 |
|
| notation |
CHEBI:145428 |
|
| prefLabel |
glasdegib |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| smiles |
N([C@H]1C[C@@H](N(CC1)C)C=2NC=3C(N2)=CC=CC3)C(=O)NC=4C=CC(=CC4)C#N |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_134043 http://purl.obolibrary.org/obo/CHEBI_18379 |