loading...| Preferred Name |
pilocarpine hydrochloride |
|
| Synonyms |
(3S,4R)-3-ethyl-4-[(1-methyl-1H-imidazol-5-yl)methyl]dihydrofuran-2(3H)-one hydrochloride (+)-pilocarpine hydrochloride Pilocarpine HCl Pilocarpine monohydrochloride |
|
| Definitions |
The hydrochloride salt of (+)-pilocarpine, a medication used to treat increased pressure inside the eye and dry mouth. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_141029 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22920012 PMID:26828672 PMID:20517630 PMID:27334829 PMID:17000452 Reaxys:5364331 CAS:54-71-7 PMID:12696227 PMID:27739377 PMID:27347646 PMID:29438107 PMID:26673507 |
|
| definition |
The hydrochloride salt of (+)-pilocarpine, a medication used to treat increased pressure inside the eye and dry mouth. |
|
| formula |
C11H17ClN2O2 |
|
| has part | ||
| has_exact_synonym |
(3S,4R)-3-ethyl-4-[(1-methyl-1H-imidazol-5-yl)methyl]dihydrofuran-2(3H)-one hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+)-pilocarpine hydrochloride Pilocarpine HCl Pilocarpine monohydrochloride |
|
| id |
CHEBI:141029 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H16N2O2.ClH/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2;/h5,7-8,10H,3-4,6H2,1-2H3;1H/t8-,10-;/m0./s1 |
|
| inchikey |
RNAICSBVACLLGM-GNAZCLTHSA-N |
|
| label |
pilocarpine hydrochloride |
|
| mass |
244.718 |
|
| monoisotopicmass |
244.09786 |
|
| notation |
CHEBI:141029 |
|
| prefLabel |
pilocarpine hydrochloride |
|
| smiles |
C(C=1N(C=NC1)C)[C@@H]2[C@@H](C(=O)OC2)CC.Cl |
|
| subClassOf |