Preferred Name |
(-)-beta-caryophyllene |
|
Synonyms |
(1R,4E,9S)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene (E)-beta-caryophyllene trans-caryophyllene trans-(1R,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene caryophyllene Caryophyllene beta-Caryophyllene (-)-(E)-beta-caryophyllene |
|
Definitions |
A beta-caryophyllene in which the stereocentre adjacent to the exocyclic double bond has S configuration while the remaining stereocentre has R configuration. It is the most commonly occurring form of beta-caryophyllene, occurring in many essential oils, particularly oil of cloves. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_10357 |
|
charge |
0 |
|
database_cross_reference |
KNApSAcK:C00003110 PMID:20433083 Wikipedia:Caryophyllene PMID:18296628 PMID:20015227 PMID:27871898 PMID:21366052 PMID:18574142 PMID:21425686 PMID:21941920 Reaxys:2044564 PMID:30281175 KEGG:C09629 PMID:12409018 CAS:87-44-5 MetaCyc:CPD-8230 PMID:20398787 |
|
definition |
A beta-caryophyllene in which the stereocentre adjacent to the exocyclic double bond has S configuration while the remaining stereocentre has R configuration. It is the most commonly occurring form of beta-caryophyllene, occurring in many essential oils, particularly oil of cloves. |
|
formula |
C15H24 |
|
has_exact_synonym |
(1R,4E,9S)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(E)-beta-caryophyllene trans-caryophyllene trans-(1R,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene caryophyllene Caryophyllene beta-Caryophyllene (-)-(E)-beta-caryophyllene |
|
id |
CHEBI:10357 |
|
in_subset | ||
inchi |
InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-/m1/s1 |
|
inchikey |
NPNUFJAVOOONJE-GFUGXAQUSA-N |
|
is_enantiomer_of | ||
label |
(-)-beta-caryophyllene |
|
mass |
204.35110 |
|
monoisotopicmass |
204.18780 |
|
notation |
CHEBI:10357 |
|
prefLabel |
(-)-beta-caryophyllene |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_48318 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
smiles |
[H][C@]12CC(C)(C)[C@]1([H])CC\C(C)=C\CCC2=C |
|
subClassOf |