Preferred Name |
resveratrol |
|
Synonyms |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|
Definitions |
A stilbenol that is stilbene in which the phenyl groups are substituted at positions 3, 5, and 4' by hydroxy groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27881 |
|
database_cross_reference |
DrugBank:DB02709 LINCS:LSM-2557 CAS:501-36-0 |
|
definition |
A stilbenol that is stilbene in which the phenyl groups are substituted at positions 3, 5, and 4' by hydroxy groups. |
|
formula |
C14H12O3 |
|
has role | ||
has_exact_synonym |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|
label |
resveratrol |
|
prefixIRI |
CHEBI:27881 |
|
prefLabel |
resveratrol |
|
smiles |
[H]C(=C([H])c1cc(O)cc(O)c1)c1ccc(O)cc1 |
|
subClassOf |
Create mapping