Preferred Name |
benzoate |
|
Synonyms |
benzoate Benzenecarboxylate Phenylformate Benzeneformate Benzenemethanoate benzoic acid, ion(1-) benzoate anion Phenylcarboxylate |
|
Definitions |
The simplest member of the class of benzoates that is the conjugate base of benzoic acid, comprising a benzoic acid core with a proton missing to give a charge of -1. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16150 |
|
charge |
-1 |
|
database_cross_reference |
MetaCyc:BENZOATE KEGG:C00180 CAS:766-76-7 Reaxys:1862486 UM-BBD_compID:c0121 Beilstein:1862486 HMDB:HMDB0001870 Gmelin:2945 |
|
formula |
C7H5O2 |
|
has role | ||
has_alternative_id |
CHEBI:13879 CHEBI:22717 |
|
has_exact_synonym |
benzoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Benzenecarboxylate Phenylformate Benzeneformate Benzenemethanoate benzoic acid, ion(1-) benzoate anion Phenylcarboxylate |
|
id |
CHEBI:16150 |
|
in_subset | ||
inchi |
InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 |
|
inchikey |
WPYMKLBDIGXBTP-UHFFFAOYSA-M |
|
is_conjugate_base_of | ||
label |
benzoate |
|
mass |
121.11340 |
|
monoisotopicmass |
121.02950 |
|
notation |
CHEBI:16150 |
|
prefLabel |
benzoate |
|
smiles |
[O-]C(=O)c1ccccc1 |
|
textual definition |
The simplest member of the class of benzoates that is the conjugate base of benzoic acid, comprising a benzoic acid core with a proton missing to give a charge of -1. |
|
subClassOf |