loading...| Preferred Name | Etidocaine | |
| Synonyms |
etidocainum (+-)-2-(Ethylpropylamino)-2',6'-butyroxylidide (+-)-N-(2,6-Dimethylphenyl)-2-(ethylpropylamino)butanamide etidocaina etidocaine N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide |
|
| Definitions |
An amino acid amide in which 2-[ethyl(propyl)amino]butanoic acid and 2,6-dimethylaniline have combined to form the amide bond. Used as a local anaesthetic (amide caine), it has rapid onset and long action properties, similar to bupivacaine, and is given by injection during surgical procedures and during labour and delivery. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4904 |
|
| alternative term |
etidocainum (+-)-2-(Ethylpropylamino)-2',6'-butyroxylidide (+-)-N-(2,6-Dimethylphenyl)-2-(ethylpropylamino)butanamide etidocaina etidocaine N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
Beilstein:2741181 CAS:36637-18-0 KEGG:D04095 PMID:9989796 Reaxys:2741181 KEGG:C07530 Drug_Central:1097 Wikipedia:Etidocaine |
|
| formula |
C17H28N2O |
|
| has role | ||
| has_alternative_id |
CHEBI:106883 |
|
| has_exact_synonym |
N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
etidocainum (+-)-2-(Ethylpropylamino)-2',6'-butyroxylidide (+-)-N-(2,6-Dimethylphenyl)-2-(ethylpropylamino)butanamide etidocaina etidocaine |
|
| has_RxCUI |
4171 |
|
| id |
CHEBI:4904 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H28N2O/c1-6-12-19(8-3)15(7-2)17(20)18-16-13(4)10-9-11-14(16)5/h9-11,15H,6-8,12H2,1-5H3,(H,18,20) |
|
| inchikey |
VTUSIVBDOCDNHS-UHFFFAOYSA-N |
|
| label |
etidocaine Etidocaine |
|
| mass |
276.41700 |
|
| monoisotopicmass |
276.22016 |
|
| notation |
CHEBI:4904 |
|
| prefixIRI |
CHEBI:4904 |
|
| prefLabel |
Etidocaine |
|
| smiles |
CCCN(CC)C(CC)C(=O)Nc1c(C)cccc1C |
|
| textual definition |
An amino acid amide in which 2-[ethyl(propyl)amino]butanoic acid and 2,6-dimethylaniline have combined to form the amide bond. Used as a local anaesthetic (amide caine), it has rapid onset and long action properties, similar to bupivacaine, and is given by injection during surgical procedures and during labour and delivery. |
|
| subClassOf |