loading...| Preferred Name | Zidovudine | |
| Synonyms |
Zidovudinum Azidothymidine AZT Retrovir Zidovudin zidovudine 3'-azido-3'-deoxythymidine |
|
| Definitions |
A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_10110 |
|
| alternative term |
Zidovudinum Azidothymidine AZT Retrovir Zidovudin zidovudine 3'-azido-3'-deoxythymidine |
|
| bearer_of |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Zidovudine KEGG:C07210 PDBeChem:AZZ PMID:9203666 KEGG:D00413 PMID:19112024 Drug_Central:2861 DrugBank:DB00495 MetaCyc:CPD-15110 LINCS:LSM-5806 CAS:30516-87-1 PMID:26859826 Patent:US4724232 Beilstein:763034 PMID:29438107 |
|
| formula |
C10H13N5O4 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
| has_alternative_id |
CHEBI:619601 |
|
| has_exact_synonym |
3'-azido-3'-deoxythymidine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Zidovudinum Azidothymidine AZT Retrovir Zidovudin zidovudine |
|
| has_RxCUI |
11413 |
|
| id |
CHEBI:10110 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1 |
|
| inchikey |
HBOMLICNUCNMMY-XLPZGREQSA-N |
|
| label |
zidovudine Zidovudine |
|
| mass |
267.24130 |
|
| monoisotopicmass |
267.09675 |
|
| notation |
CHEBI:10110 |
|
| prefixIRI |
CHEBI:10110 |
|
| prefLabel |
Zidovudine |
|
| smiles |
Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O |
|
| textual definition |
A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
|
| subClassOf |