loading...| Preferred Name |
Ifosfamide |
|
| Synonyms |
N,3-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide C7H15Cl2N2O2P ifosfamidum isosfamide ifosfamida Isofosfamide ClCCNP1(=O)OCCCN1CCCl ifosfamide Iphosphamide Isophosphamide InChI=1S/C7H15Cl2N2O2P/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-7H2,(H,10,12) 3-(2-chloroethyl)-2-((2-chloroethyl)amino)tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide InChIKey=HOMGKSMUEGBAAB-UHFFFAOYSA-N |
|
| Definitions |
A nitrogen mustard alkylating agent used in the treatment of cancer |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5864 |
|
| database_cross_reference |
ChemIDplus:3778-73-2 KEGG COMPOUND:C07047 Beilstein:611835 Wikipedia:Ifosfamide DrugBank:DB01181 ChEMBL:219640 KEGG COMPOUND:3778-73-2 KEGG DRUG:D00343 |
|
| definition |
A nitrogen mustard alkylating agent used in the treatment of cancer |
|
| has_alternative_id |
CHEBI:219640 |
|
| has_exact_synonym |
N,3-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide |
|
| has_related_synonym |
C7H15Cl2N2O2P ifosfamidum isosfamide ifosfamida Isofosfamide ClCCNP1(=O)OCCCN1CCCl ifosfamide Iphosphamide Isophosphamide InChI=1S/C7H15Cl2N2O2P/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-7H2,(H,10,12) 3-(2-chloroethyl)-2-((2-chloroethyl)amino)tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide InChIKey=HOMGKSMUEGBAAB-UHFFFAOYSA-N |
|
| has_RxCUI |
5657 |
|
| id |
CHEBI:5864 |
|
| imported from | ||
| label |
Ifosfamide ifosfamide |
|
| notation |
CHEBI:5864 |
|
| prefLabel |
Ifosfamide |
|
| subClassOf |