Jump to:
loading...| Preferred Name |
morphinan |
|
| Synonyms |
morphinan InChI=1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15+,16-/m0/s1 [H][C@@]12CCCC[C@@]11CCN[C@@H]2Cc2ccccc12 227.34468 C16H21N INAXVFBXDYWQFN-XHSDSOJGSA-N |
|
| Definitions |
An isoquinoline alkaloid fundamental parent that has formula C16H21N. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35649 |
|
| database_cross_reference |
Beilstein:1375527 |
|
| definition |
An isoquinoline alkaloid fundamental parent that has formula C16H21N. |
|
| has_exact_synonym |
morphinan |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15+,16-/m0/s1 [H][C@@]12CCCC[C@@]11CCN[C@@H]2Cc2ccccc12 227.34468 C16H21N INAXVFBXDYWQFN-XHSDSOJGSA-N |
|
| id |
CHEBI:35649 |
|
| imported from | ||
| label |
morphinan |
|
| notation |
CHEBI:35649 |
|
| prefLabel |
morphinan |
|
| subClassOf |
Create mapping