Preferred Name |
folic acid |
|
Synonyms |
|
|
Definitions |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27470 |
|
charge |
0 |
|
definition |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
|
formula |
C19H19N7O6 |
|
has role | ||
has_functional_parent | ||
inchi |
InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 |
|
inchikey |
OVBPIULPVIDEAO-LBPRGKRZSA-N |
|
is_conjugate_acid_of | ||
label |
folic acid |
|
mass |
441.39750 |
|
monoisotopicmass |
441.13968 |
|
prefixIRI |
CHEBI:27470 |
|
prefLabel |
folic acid |
|
smiles |
Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1 |
|
subClassOf |