Preferred Name |
estradiol |
|
Synonyms |
|
|
Definitions |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_23965 |
|
charge |
0 |
|
definition |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
|
formula |
C18H24O2 |
|
has role | ||
has_parent_hydride | ||
inchi |
InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17?,18+/m1/s1 |
|
inchikey |
VOXZDWNPVJITMN-WKUFJEKOSA-N |
|
label |
estradiol |
|
mass |
272.38196 |
|
monoisotopicmass |
272.17763 |
|
prefixIRI |
CHEBI:23965 |
|
prefLabel |
estradiol |
|
smiles |
[H][C@]12CC[C@]3(C)C(O)CC[C@@]3([H])[C@]1([H])CCc1cc(O)ccc21 |
|
subClassOf |
Create mapping