Preferred Name |
irbesartan |
|
Synonyms |
Irbesartan 2-butyl-3-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-1,3-diazaspiro[4.4]non-1-en-4-one BMS 186295 Avapro irbesartan 2-butyl-3-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1,3-diazaspiro[4.4]non-1-en-4-one |
|
Definitions |
A biphenylyltetrazole that is an angiotensin II receptor antagonist used mainly for the treatment of hypertension. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5959 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Irbesartan KEGG:D00523 PMID:15210574 PMID:15526904 DrugBank:DB01029 CAS:138402-11-6 Reaxys:6620400 PMID:15101793 Beilstein:6620400 Patent:US5270317 KEGG:C07469 LINCS:LSM-3338 Drug_Central:1481 Patent:WO9114679 |
|
definition |
A biphenylyltetrazole that is an angiotensin II receptor antagonist used mainly for the treatment of hypertension. |
|
formula |
C25H28N6O |
|
has exact synonym |
Irbesartan 2-butyl-3-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-1,3-diazaspiro[4.4]non-1-en-4-one |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_61016 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
BMS 186295 Avapro irbesartan 2-butyl-3-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1,3-diazaspiro[4.4]non-1-en-4-one |
|
id |
CHEBI:5959 |
|
in_subset | ||
inchi |
InChI=1S/C25H28N6O/c1-2-3-10-22-26-25(15-6-7-16-25)24(32)31(22)17-18-11-13-19(14-12-18)20-8-4-5-9-21(20)23-27-29-30-28-23/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,27,28,29,30) |
|
inchikey |
YOSHYTLCDANDAN-UHFFFAOYSA-N |
|
label |
irbesartan |
|
mass |
428.52966 |
|
monoisotopicmass |
428.23246 |
|
notation |
CHEBI:5959 |
|
prefLabel |
irbesartan |
|
smiles |
CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1 |
|
subClassOf |